CAS 54884-17-2

Benzamide, 2,4-diamino-N-methyl-

Description:

Benzamide, 2,4-diamino-N-methyl- is an organic compound characterized by its amide functional group attached to a benzene ring, along with two amino groups at the 2 and 4 positions and a methyl group at the nitrogen of the amide. This compound typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the amine and amide functionalities. Its molecular structure suggests potential for hydrogen bonding, which can influence its physical properties, such as melting and boiling points. The presence of multiple amino groups may also impart basicity and reactivity, making it of interest in various chemical reactions and applications, including pharmaceuticals and agrochemicals. Additionally, the compound may exhibit biological activity, which could be explored in medicinal chemistry. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.

Formula: C₈H₁₁N₃O

InChI: InChI=1S/C8H11N3O/c1-11-8(12)6-3-2-5(9)4-7(6)10/h2-4H,9-10H2,1H3,(H,11,12)

InChI key: InChIKey=KJEOLSJWEMEJDY-UHFFFAOYSA-N

SMILES: C(NC)(=O)C1=C(N)C=C(N)C=C1

Synonyms:

• Benzamide, 2,4-diamino-N-methyl-
• 2,4-Diamino-N-methylbenzamide

2,4-Diamino-N-methylbenzamide

CAS: 54884-17-2

Versatile small molecule scaffold

Formula: C₈H₁₁N₃O

Purity: Min. 95%

Molecular weight: 165.19 g/mol

Ref: 3D-ECA88417