CymitQuimica logo

CAS 54884-84-3

:

5,6-Decanediol

Description:
5,6-Decanediol, with the CAS number 54884-84-3, is a linear aliphatic diol characterized by the presence of two hydroxyl (-OH) functional groups located at the 5th and 6th carbon atoms of a decane chain. This compound is a colorless, viscous liquid at room temperature and is soluble in water due to its hydroxyl groups, which can form hydrogen bonds. It has a relatively high boiling point and moderate viscosity, making it useful in various applications, including as a building block in the synthesis of polymers, surfactants, and other chemical intermediates. The presence of two hydroxyl groups allows for increased reactivity, enabling it to participate in condensation reactions and serve as a plasticizer or humectant in formulations. Additionally, 5,6-decanediol exhibits low toxicity, making it a safer alternative in certain industrial applications. Its physical and chemical properties make it suitable for use in cosmetics, personal care products, and as a potential additive in food and pharmaceuticals.
Formula:C10H22O2
InChI:InChI=1S/C10H22O2/c1-3-5-7-9(11)10(12)8-6-4-2/h9-12H,3-8H2,1-2H3
InChI key:InChIKey=FUGIIBWTNARRSF-UHFFFAOYSA-N
SMILES:C(C(CCCC)O)(CCCC)O
Synonyms:
  • 5,6-Decanediol
  • 5,6-Dihydroxydecane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.