CAS 54898-34-9
:1-(2-chloro-2-deoxypentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione
Description:
1-(2-Chloro-2-deoxypentofuranosyl)-5-methylpyrimidine-2,4(1H,3H)-dione is a chemical compound characterized by its unique structural features, which include a pyrimidine ring and a deoxypentofuranosyl moiety. The presence of a chlorine atom at the 2-position of the deoxypentofuranosyl group contributes to its reactivity and potential biological activity. This compound is classified as a nucleoside analog, which may exhibit antiviral or anticancer properties due to its structural similarity to natural nucleosides. The methyl group at the 5-position of the pyrimidine ring can influence its interaction with biological targets, such as enzymes or receptors. Additionally, the diketone functional groups in the pyrimidine structure may participate in various chemical reactions, including tautomerization and hydrogen bonding. Overall, this compound's characteristics suggest potential applications in medicinal chemistry and biochemistry, particularly in the development of therapeutic agents. However, specific properties such as solubility, stability, and biological activity would require further empirical investigation.
Formula:C10H13ClN2O5
InChI:InChI=1/C10H13ClN2O5/c1-4-2-13(10(17)12-8(4)16)9-6(11)7(15)5(3-14)18-9/h2,5-7,9,14-15H,3H2,1H3,(H,12,16,17)
SMILES:Cc1cn(C2C(C(C(CO)O2)O)Cl)c(=O)nc1O
Synonyms:- 2,4(1H,3H)-pyrimidinedione, 1-(2-chloro-2-deoxypentofuranosyl)-5-methyl-
- 2’-Chloro-2’-deoxy-5-methyluridine, 2’-Chlorothymidine
- NSC 529514
- 2'-Chloro-2'-deoxy-5-Methyluridine
- Uridine, 2'-chloro-2'-deoxy-5-methyl-
- 2'-chlorothymidine
- 2'-Deoxy-2'-chloro-5-methyluridine
- 2'-Chloro-2'-deoxythymidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2'-Chlorothymidine
CAS:2'-Chlorothymidine is a Halo-nucleoside; 5-modified pyrimidine nucleoside.Formula:C10H13ClN2O5Color and Shape:SolidMolecular weight:276.67Ref: TM-TNU0075
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire
