CAS 5490-92-6
:9H-xanthen-9-ylmethanol
Description:
9H-xanthen-9-ylmethanol, with the CAS number 5490-92-6, is an organic compound characterized by its xanthene structure, which consists of a fused ring system that includes a benzene ring and a central oxygen atom. This compound features a hydroxymethyl group (-CH2OH) attached to the xanthene core, which contributes to its reactivity and potential applications. It is typically a colorless to pale yellow solid or liquid, depending on its purity and form. The presence of the hydroxymethyl group allows for hydrogen bonding, influencing its solubility in polar solvents such as water and alcohols. 9H-xanthen-9-ylmethanol is of interest in various fields, including organic synthesis and materials science, due to its fluorescent properties and potential use in dye applications. Additionally, it may serve as a precursor for the synthesis of other xanthene derivatives, which are valuable in the development of fluorescent probes and sensors. Safety data should be consulted for handling and storage, as with all chemical substances.
Formula:C14H12O2
InChI:InChI=1/C14H12O2/c15-9-12-10-5-1-3-7-13(10)16-14-8-4-2-6-11(12)14/h1-8,12,15H,9H2
SMILES:c1ccc2c(c1)C(CO)c1ccccc1O2
Synonyms:- 9H-Xanthene-9-methanol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(9H-Xanthen-9-yl)methanol
CAS:<p>(9H-Xanthen-9-yl)methanol</p>Purity:>98%Molecular weight:212.24g/mol9H-Xanthene-9-methanol
CAS:<p>9H-Xanthene-9-methanol is an orthogonal protecting group for amines, carbanions, and other nucleophiles. It is a multistep process that yields a cationic intermediate, which can be used for the synthesis of amine-containing compounds. 9H-Xanthene-9-methanol is also used in the deprotection of photolabile groups such as sulfonyl chlorides and tosylates. The reactivity of this reagent is optimized when it is combined with acidic solvents, such as dichloromethane or chloroform.</p>Formula:C14H12O2Purity:Min. 95%Molecular weight:212.25 g/mol
