CAS 54903-50-3: 4,5,6,7-Tetrahydrothieno[3,2-c]pyridine

Description:4,5,6,7-Tetrahydrothieno[3,2-c]pyridine is a heterocyclic organic compound characterized by its bicyclic structure, which consists of a thiophene ring fused to a pyridine ring. This compound features a saturated tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the carbon atoms in the rings. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure contributes to its properties, including solubility in organic solvents and potential interactions with biological targets. The presence of nitrogen and sulfur in its structure can influence its reactivity and stability. As with many heterocycles, it may exhibit unique electronic properties, which can be leveraged in various chemical applications. Safety data should be consulted for handling and storage, as with any chemical substance.

Formula:C₇H₉NS

InChI:InChI=1S/C7H9NS/c1-3-8-5-6-2-4-9-7(1)6/h2,4,8H,1,3,5H2

InChI key:InChIKey=OGUWOLDNYOTRBO-UHFFFAOYSA-N

SMILES:S1C=CC2=C1CCNC2

Synonyms:
4,5,6,7-Hexahydrothieno[3,2-C]Pyridine
4,5,6,7-Tetrahydro-1H-thieno[3,2-c]pyridine
6,7-Dihydro-4H-thieno[3,2-c]pyridine
Pcr 0665
Thieno[3,2-c]pyridine, 4,5,6,7-tetrahydro-
4,5,6,7-Tetrahydrothieno[3,2-c]pyridine

Found 4 products.

Product data	Purity	Price range	Estimated delivery
4,5,6,7-Tetrahydrothieno[3,2-c]pyridine REF: 3B-T2686CAS: 54903-50-3	>98.0%(GC)(T)	103.00 €~316.00 €	Tue 05 Aug 25
Thieno[3,2-c]pyridine, 4,5,6,7-tetrahydro- REF: IN-DA00I9SWCAS: 54903-50-3	95%	To inquire	Tue 12 Aug 25
4,5,6,7-Tetrahydrothieno[3,2-C]Pyridine REF: 54-OR1011329CAS: 54903-50-3	98%	32.00 €~1,592.00 €	Wed 13 Aug 25
4,5,6,7-Tetrahydrothieno[3,2-c]pyridine REF: 10-F069149CAS: 54903-50-3	97.0%	To inquire	Fri 22 Aug 25