CAS 54916-65-3
:5-chloro-2-methoxypyridine-3-carboxylic acid
Description:
5-Chloro-2-methoxypyridine-3-carboxylic acid is a heterocyclic organic compound characterized by its pyridine ring, which contains both a chlorine atom and a methoxy group as substituents. The presence of the carboxylic acid functional group contributes to its acidic properties, making it soluble in polar solvents. This compound is typically used in pharmaceutical and agrochemical research due to its potential biological activity. The chlorine atom introduces electronegativity, influencing the compound's reactivity and interaction with biological targets. The methoxy group can enhance lipophilicity, affecting the compound's absorption and distribution in biological systems. Additionally, the specific positioning of these substituents on the pyridine ring can impact the compound's overall stability and reactivity, making it a subject of interest in synthetic organic chemistry. Overall, 5-chloro-2-methoxypyridine-3-carboxylic acid is a versatile compound with applications in various fields, including medicinal chemistry and material science.
Formula:C7H6ClNO3
InChI:InChI=1/C7H6ClNO3/c1-12-6-5(7(10)11)2-4(8)3-9-6/h2-3H,1H3,(H,10,11)
SMILES:COc1c(cc(cn1)Cl)C(=O)O
Synonyms:- 3-Pyridinecarboxylic Acid, 5-Chloro-2-Methoxy-
- 5-Chloro-2-methoxynicotinic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
5-Chloro-2-methoxynicotinic acid
CAS:Formula:C7H6ClNO3Purity:98%Color and Shape:SolidMolecular weight:187.58045-Chloro-2-methoxynicotinic acid
CAS:5-Chloro-2-methoxynicotinic acidFormula:C7H6ClNO3Purity:98%Color and Shape: white solidMolecular weight:187.58g/mol5-Chloro-2-methoxynicotinic acid
CAS:Formula:C7H6ClNO3Purity:98%Color and Shape:Solid, No data available.Molecular weight:187.585-Chloro-2-methoxynicotinic acid
CAS:5-Chloro-2-methoxynicotinic acid (5CMA) is a hypochlorite, which is an inorganic compound that contains the elements chlorine and oxygen. It belongs to the class of alkali metal hypochlorites, which are strong oxidizing agents. 5CMA is used as a reagent in organic synthesis, such as for chlorination of benzene rings. It has been shown to be effective for lowering blood glucose levels. 5CMA is also used as a solvent system for oral hypoglycemic agents, such as sulfonylurea derivatives and alpha-glucosidase inhibitors. The chlorinating agent can be replaced with a more benign substance that does not produce hazardous byproducts when mixed with water or other substances. 5CMA has also been shown to have oral hypoglycemic effects because it decreases the absorption of glucose from the intestine and stimulates insulin release from pancreatic β cells.Formula:C7H6ClNO3Purity:Min. 95%Molecular weight:187.58 g/mol



