CAS 54924-47-9: 3-amino-1,3-oxazinan-2-one

Description: 3-Amino-1,3-oxazinan-2-one, with the CAS number 54924-47-9, is a heterocyclic organic compound characterized by a six-membered ring containing both nitrogen and oxygen atoms. The structure features an amino group (-NH2) and a carbonyl group (C=O) within the oxazinan ring, contributing to its reactivity and potential biological activity. This compound is typically a white to off-white solid and is soluble in polar solvents, which is common for many heterocycles. Its unique structure allows it to participate in various chemical reactions, including nucleophilic substitutions and cyclization processes. The presence of the amino group suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it may interact with biological targets. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 3-amino-1,3-oxazinan-2-one represents a versatile scaffold for further chemical modifications and research in organic synthesis and drug development.

Formula: C₄H₈N₂O₂

InChI: InChI=1/C4H8N2O2/c5-6-2-1-3-8-4(6)7/h1-3,5H2

Synonyms:

• 3-Aminotetrahydro-1,3-oxazin-2-one

3-Amino-1,3-oxazinan-2-one

CAS: 54924-47-9

• Purity: 97%
• Molecular weight: 116.12000274658203

3-Aminotetrahydro-1,3-oxazin-2-one

CAS: 54924-47-9

Please enquire for more information about 3-Aminotetrahydro-1,3-oxazin-2-one including the price, delivery time and more detailed …

• Formula: C₄H₈N₂O₂
• Purity: Min. 95%
• Molecular weight: 116.12 g/mol