CAS 54925-33-6

Cytidine, cyclic 3′,5′-(hydrogen phosphate), sodium salt (1:1)

Description:

Cytidine, cyclic 3′,5′-(hydrogen phosphate), sodium salt (1:1), commonly referred to as cyclic CMP, is a nucleotide derivative characterized by its cyclic phosphate structure. This compound features a cytidine base linked to a cyclic phosphate group, which plays a crucial role in various biochemical processes, including signal transduction and cellular regulation. As a sodium salt, it is soluble in water, making it suitable for biological applications. The cyclic nature of the phosphate group imparts unique properties, such as stability against hydrolysis compared to linear phosphates. This compound is often utilized in research related to nucleic acid chemistry, enzymatic reactions, and as a potential signaling molecule in cellular pathways. Its CAS number, 54925-33-6, allows for precise identification in chemical databases. Overall, cyclic CMP serves as an important tool in molecular biology and biochemistry, contributing to our understanding of cellular mechanisms and the development of therapeutic agents.

Formula: C₉H₁₂N₃O₇P·Na

InChI: InChI=1S/C9H12N3O7P.Na/c10-5-1-2-12(9(14)11-5)8-6(13)7-4(18-8)3-17-20(15,16)19-7;/h1-2,4,6-8,13H,3H2,(H,15,16)(H2,10,11,14);/t4-,6-,7-,8-;/m1./s1

InChI key: InChIKey=ONYIALNOFINMRC-IAIGYFSYSA-N

SMILES: O[C@H]1[C@@H](O[C@]2([C@]1(OP(=O)(O)OC2)[H])[H])N3C(=O)N=C(N)C=C3.[Na]

Synonyms:

• 4H-Furo[3,2-d]-1,3,2-dioxaphosphorin, cytidine deriv.
• Cytidine, cyclic 3′,5′-(hydrogen phosphate), monosodium salt
• Cytidine, cyclic 3′,5′-(hydrogen phosphate), sodium salt (1:1)

Cytidine-3'',5''-cyclic monophosphate monosodium salt

CAS: 54925-33-6

Formula: C₉H₁₁N₃O₇PNa

Molecular weight: 327.16

Ref: 7W-GN4002

Cytidine 3',5'-cyclic monophosphate monosodium

CAS: 54925-33-6

Cytidine 3',5'-cyclic monophosphate monosodium is a phosphotriester that is used as a building block to synthesize ribonucleosides, uridine, guanosine, and cytidine. The phosphate group in the molecule can be removed by nucleophilic substitution with ammonia or sodium hydroxide to form the corresponding nucleosides. Cytidine 3',5'-cyclic monophosphate monosodium has been shown to inhibit bacterial growth.

Formula: C₉H₁₁N₃O₇PNa

Purity: Min. 95%

Color and Shape: White Powder

Molecular weight: 327.16 g/mol

Ref: 3D-NC09356