CAS 54925-88-1
:L-Tyrosyl-L-lysine
Description:
L-Tyrosyl-L-lysine, with the CAS number 54925-88-1, is a dipeptide composed of the amino acids tyrosine and lysine. It features a peptide bond linking the carboxyl group of tyrosine to the amino group of lysine. This compound is characterized by its potential biological activity, particularly in the context of protein synthesis and cellular signaling. L-Tyrosyl-L-lysine may exhibit properties such as solubility in water, which is typical for many peptides, and it can participate in various biochemical reactions due to the functional groups present in its amino acid constituents. The presence of the aromatic side chain from tyrosine may contribute to its interactions with other biomolecules, while the positively charged side chain of lysine can influence its role in cellular processes. Additionally, this dipeptide may be of interest in research related to nutrition, pharmacology, and the development of peptide-based therapeutics. Its stability and reactivity can vary depending on environmental conditions such as pH and temperature.
Formula:C15H23N3O4
InChI:InChI=1S/C15H23N3O4/c16-8-2-1-3-13(15(21)22)18-14(20)12(17)9-10-4-6-11(19)7-5-10/h4-7,12-13,19H,1-3,8-9,16-17H2,(H,18,20)(H,21,22)/t12-,13-/m0/s1
InChI key:InChIKey=AOLHUMAVONBBEZ-STQMWFEESA-N
SMILES:C([C@@H](C(N[C@@H](CCCCN)C(O)=O)=O)N)C1=CC=C(O)C=C1
Synonyms:- 164: PN: EP2161028 PAGE: 10 claimed protein
- L-Tyrosyl-L-lysine
- 195: PN: WO2011146121 PAGE: 117 claimed sequence
- L-Lysine, N2-L-tyrosyl-
- L-Lysine, L-tyrosyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
H-Tyr-Lys-OH
CAS:Reaction of the dipeptide KY with diethylenetriaminepentaacetic (DTPA) cyclic anhydride yielded monovalent and bivalent haptens. In vitro, the antibody conjugate (which was prepared by coupling F(ab’)2 or Fab’ fragments of an antibody specific for the human high molecular weight melanoma associated antigen to Fab’ fragments of an antibody specific for In-DTPA complexes) mediated binding of the ¹¹¹In-labeled haptens to melanoma cells. In vivo, it allowed specific localization of the haptens in A375 tumors. The bivalent hapten exhibited much higher efficiency at targeting ¹¹¹In onto cells, both in vitro and in vivo.Formula:C15H23N3O4Purity:> 99%Color and Shape:White Crystalline PowderMolecular weight:309.37H-Tyr-Lys-OH
CAS:H-Tyr-Lys-OH is a small drug molecule that has been shown to inhibit protein synthesis. It binds to the active site of the transcription-polymerase chain and competitively inhibits the binding of RNA polymerase. H-Tyr-Lys-OH has also been shown to have anti-inflammatory properties, which may be due to its ability to inhibit prostaglandin synthesis. H-Tyr-Lys-OH's conformational properties are similar to those found in proteins such as glutamic acid and lysine.Formula:C15H23N3O4Purity:Min. 95%Molecular weight:309.36 g/mol

