CAS 54930-23-3

4-[(2-methoxyethyl)amino]-4-oxobut-2-enoic acid

Description:

4-[(2-Methoxyethyl)amino]-4-oxobut-2-enoic acid, with the CAS number 54930-23-3, is an organic compound characterized by its unique functional groups and structural features. It contains an α,β-unsaturated carbonyl system, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methoxyethyl group suggests that it may exhibit solubility in polar solvents, enhancing its utility in various chemical reactions. This compound may also participate in nucleophilic addition reactions due to the electrophilic nature of the carbonyl group. Additionally, the amino group can engage in hydrogen bonding, influencing its physical properties and interactions with biological systems. The overall structure indicates potential for use in medicinal chemistry, possibly as a precursor or intermediate in the synthesis of pharmaceuticals. Its stability, reactivity, and solubility characteristics would be essential for determining its practical applications in research and industry. As with any chemical substance, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₇H₁₁NO₄

InChI: InChI=1/C7H11NO4/c1-12-5-4-8-6(9)2-3-7(10)11/h2-3H,4-5H2,1H3,(H,8,9)(H,10,11)

SMILES: COCCN=C(C=CC(=O)O)O

(Z)-4-(2-METHOXYETHYLAMINO)-4-OXOBUT-2-ENOIC ACID

CAS: 54930-23-3

Formula: C₇H₁₁NO₄

Purity: 95.0%

Molecular weight: 173.168

Ref: 10-F306396