CAS 54932-72-8
:5-Bromo-2-chlorotoluene
Description:
5-Bromo-2-chlorotoluene is an organic compound characterized by the presence of both bromine and chlorine substituents on a toluene ring. Its molecular structure consists of a toluene backbone, which is a methyl-substituted benzene, with a bromine atom located at the 5-position and a chlorine atom at the 2-position of the aromatic ring. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its applications in organic synthesis, particularly in the production of pharmaceuticals and agrochemicals, due to the reactivity of the halogen substituents. The presence of these halogens can influence the compound's physical properties, such as boiling and melting points, as well as its solubility in various solvents. Additionally, 5-Bromo-2-chlorotoluene may exhibit moderate toxicity, necessitating careful handling and appropriate safety measures during its use in laboratory or industrial settings.
Formula:C7H6BrCl
InChI:InChI=1S/C7H6BrCl/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3
InChI key:InChIKey=OZFQMHJKAODEON-UHFFFAOYSA-N
SMILES:CC1=C(Cl)C=CC(Br)=C1
Synonyms:- 2-Chloro-5-bromotoluene
- 4-Bromo-1-Chloro-2-Methylbenzene
- 4-Chloro-3-methylbromobenzene
- 5-Bromo-2-chloro-1-methylbenzene
- Benzene, 4-bromo-1-chloro-2-methyl-
- Toluene, 5-bromo-2-chloro-
- 5-Bromo-2-chlorotoluene
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
5-Bromo-2-chlorotoluene
CAS:Formula:C7H6BrClPurity:>98.0%(GC)Color and Shape:Colorless to Yellow clear liquidMolecular weight:205.485-Bromo-2-chlorotoluene, 98%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C7H6BrClPurity:98%Color and Shape:Clear colorless, LiquidMolecular weight:205.485-Bromo-2-chlorotoluene
CAS:Formula:C7H6BrClPurity:98%Color and Shape:LiquidMolecular weight:205.47955-Bromo-2-chlorotoluene
CAS:<p>5-Bromo-2-chlorotoluene</p>Formula:C7H6BrClPurity:≥95%Color and Shape: clear. faint yellow liquidMolecular weight:205.48g/mol5-Bromo-2-chlorotoluene
CAS:5-Bromo-2-chlorotoluene is a fluorophore molecule that can be modified to produce a variety of fluorescent properties. Fluorophores are molecules that are able to absorb light and emit light at a different wavelength, which makes them useful in research as they can be used to visualize molecules and their interactions with other molecules. The discovery and modification of fluorophores has played an important role in the development of new imaging techniques such as MRI scans. A molecule's spectrum can provide information about its structure, so 5-bromo-2-chlorotoluene's spectrum provides insight into its molecular structure.Formula:C7H6BrClPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:205.48 g/mol





