CAS 54932-77-3
:2,5-di(butan-2-yl)phenol
Description:
2,5-Di(butan-2-yl)phenol, with the CAS number 54932-77-3, is an organic compound characterized by its phenolic structure, which features two butan-2-yl groups attached to the 2 and 5 positions of a phenol ring. This compound typically exhibits properties associated with phenols, such as being a solid at room temperature and having a relatively high boiling point due to the presence of the bulky butan-2-yl substituents. It is likely to be hydrophobic, showing limited solubility in water but good solubility in organic solvents. The presence of the hydroxyl (-OH) group imparts some degree of polarity, allowing for potential hydrogen bonding interactions. 2,5-Di(butan-2-yl)phenol may be used in various applications, including as an intermediate in organic synthesis or as an additive in materials to enhance thermal stability or antioxidant properties. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance.
Formula:C14H22O
InChI:InChI=1/C14H22O/c1-5-10(3)12-7-8-13(11(4)6-2)14(15)9-12/h7-11,15H,5-6H2,1-4H3
SMILES:CCC(C)c1ccc(C(C)CC)c(c1)O
Synonyms:- 2,5-Disec-butylphenol
- Phenol, 2,5-bis(1-methylpropyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ref: 4Z-P-5751
Discontinued product
