CAS 54944-38-6

1-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-8-hydroxy-3-methyl-9,10-anthracenedione

Description:

1-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-8-hydroxy-3-methyl-9,10-anthracenedione, commonly referred to as a glycosylated anthraquinone derivative, exhibits several notable characteristics. This compound features a complex structure that includes an anthraquinone core, which is known for its vibrant color and potential applications in dyes and pigments. The presence of glucopyranosyl moieties suggests that it is a glycoside, which may enhance its solubility in water and biological systems, potentially increasing its bioavailability. The hydroxyl group at the 8-position contributes to its reactivity and may play a role in its biological activity, including antioxidant properties. Additionally, the compound's structure indicates potential interactions with biological macromolecules, which could be relevant in pharmacological contexts. Overall, this substance may have applications in medicinal chemistry, particularly in the development of therapeutic agents, due to its unique structural features and the biological significance of anthraquinones.

Formula: C₂₇H₃₀O₁₄

InChI: InChI=1S/C27H30O14/c1-9-5-11-17(21(33)16-10(18(11)30)3-2-4-12(16)29)13(6-9)39-27-25(37)23(35)20(32)15(41-27)8-38-26-24(36)22(34)19(31)14(7-28)40-26/h2-6,14-15,19-20,22-29,31-32,34-37H,7-8H2,1H3/t14-,15-,19-,20-,22+,23+,24-,25-,26-,27-/m1/s1

InChI key: InChIKey=FKODDFZWQVWOAW-ONMHTNRHSA-N

SMILES: O(C1=C2C(C(=O)C=3C(C2=O)=C(O)C=CC3)=CC(C)=C1)[C@@H]4O[C@H](CO[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@H]4O

Synonyms:

• 9,10-Anthracenedione, 1-[(6-O-β-D-glucopyranosyl-β-D-glucopyranosyl)oxy]-8-hydroxy-3-methyl-
• 1-[(6-O-β-D-Glucopyranosyl-β-D-glucopyranosyl)oxy]-8-hydroxy-3-methyl-9,10-anthracenedione
• Chrysophanol 1-O-β-gentiobioside

Chrysophanol-1-O-β-gentiobioside

CAS: 54944-38-6

Formula: C₂₇H₃₀O₁₄

Molecular weight: 578.52

Ref: 7W-GY7293

Chrysophanol-1-O-β-gentiobioside

CAS: 54944-38-6

Chrysophanol-1-O-β-gentiobioside, an anthraquinone glycoside obtained from the seeds of Cassia obtusifolia, exhibits targeted inhibition of hMAO-A isozyme

Formula: C₂₇H₃₀O₁₄

Color and Shape: Solid

Molecular weight: 578.52

Ref: TM-T40628

Chrysophanol-1-O-β-gentiobioside

CAS: 54944-38-6

Formula: C₂₇H₃₀O₁₄

Purity: 95%~99%

Molecular weight: 578.523

Ref: BP-BP4459

Chrysophanol-o-β-gentiobioside

CAS: 54944-38-6

Chrysophanol-o-β-gentiobioside is a glycosylated anthraquinone compound, which is typically derived from traditional medicinal plants such as Rheum palmatum, commonly known as Chinese rhubarb. This compound exhibits its activities through various biological pathways, primarily impacting cellular functions involved in antioxidant, anti-inflammatory, and antimicrobial processes.

Formula: C₂₇H₃₀O₁₄

Purity: Min. 95%

Molecular weight: 578.5 g/mol

Ref: 3D-ECA94438