CAS 54947-34-1

Glucosamineoximehydrochlorid; 99%

Description:

Glucosamine oxime hydrochloride, with the CAS number 54947-34-1, is a chemical compound derived from glucosamine, an amino sugar that plays a crucial role in the formation of cartilage and other connective tissues. This substance is characterized by its oxime functional group, which is formed by the reaction of glucosamine with hydroxylamine. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for potential therapeutic applications. Glucosamine oxime hydrochloride is often studied for its potential benefits in joint health and its role in the synthesis of glycosaminoglycans, which are vital for maintaining cartilage integrity. The compound is generally characterized by its white crystalline appearance and is used in various research contexts, particularly in studies related to osteoarthritis and other musculoskeletal disorders. Its purity, often stated as 99%, indicates a high level of refinement, making it suitable for both laboratory research and potential pharmaceutical applications. Safety data should be consulted for handling and usage guidelines, as with any chemical substance.

Formula: C₆H₁₄N₂O₅

InChI: InChI=1/C6H14N2O5/c7-3(1-8-13)5(11)6(12)4(10)2-9/h1,3-6,9-13H,2,7H2/b8-1+

Synonyms:

• D-Glucosamine-oxime hydrochlorid
• (6E)-5-amino-6-(hydroxyimino)hexane-1,2,3,4-tetrol (non-preferred name)

D-Glucosamine-oxime HCl

CAS: 54947-34-1

Formula: C₆H₁₅ClN₂O₅

Color and Shape: Solid

Molecular weight: 230.6467

Ref: IN-DA003PA3

D-Glucosamine-oxime hydrochloride

CAS: 54947-34-1

Ref: 7W-GC2488

D-Glucosamine-oxime hydrochloride

CAS: 54947-34-1

D-Glucosamine-oxime HCl is a hydrocyanic acid derivative that contains a polyhydroxy group. It can exist as two isomers, D-glucosamine and D-glucosamine-oxime. These isomers are distinguished by the presence or absence of acetyl groups on the nitrogen atoms. D-Glucosamine-oxime HCl functions as a divalent metal ion chelator and sequestering agent that has been shown to be useful in the treatment of lead poisoning. It also has been used in the synthesis of hydrocyanic acid, which is an important chemical for organic synthesis.END>

Formula: C₆H₁₂N₂O₅•HCl

Purity: Min. 95%

Color and Shape: Solid

Molecular weight: 228.63 g/mol

Ref: 3D-MG07026