CAS 54949-92-7
:2,3-Dihydro-1H-indene-1-methanamine
Description:
2,3-Dihydro-1H-indene-1-methanamine, with the CAS number 54949-92-7, is an organic compound characterized by its bicyclic structure, which consists of a dihydroindene moiety with an amine functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the amine group imparts basic properties, allowing it to participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions. Additionally, the bicyclic structure contributes to its unique reactivity and stability. Safety data indicates that, like many amines, it should be handled with care due to potential irritant properties. Overall, 2,3-Dihydro-1H-indene-1-methanamine is a compound of interest in both academic research and industrial applications, particularly in the fields of medicinal chemistry and materials science.
Formula:C10H13N
InChI:InChI=1/C10H13N/c11-7-9-6-5-8-3-1-2-4-10(8)9/h1-4,9H,5-7,11H2
SMILES:c1ccc2c(c1)CCC2CN
Synonyms:- 1-(2,3-Dihydro-1H-inden-1-yl)methanamin
- 1-(2,3-Dihydro-1H-inden-1-yl)methanamine
- 1H-indene-1-methanamine, 2,3-dihydro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
1H-Indene-1-methanamine, 2,3-dihydro-
CAS:<p>Indene-1-methanamine is a drug that has been used for the treatment of neurologic disorders and is an ester of aliphatic hydrocarbons. It has been shown to have antidepressant effects in animal models, which may be due to its ability to bind to 5-HT1A receptors. Indene-1-methanamine also has antimicrobial properties and can be used for treating bladder infections as well as cancer. This drug binds to the quinolizine site on bacterial DNA gyrase, which inhibits DNA synthesis and leads to cell death.</p>Formula:C10H13N·HClPurity:90%MinMolecular weight:183.68 g/mol
