CAS 54954-44-8

3-(4-phenoxyphenyl)propanal

Description:

3-(4-Phenoxyphenyl)propanal, with the CAS number 54954-44-8, is an organic compound characterized by its aldehyde functional group and a phenoxyphenyl substituent. This compound features a three-carbon propanal chain attached to a phenyl group that is further substituted with a phenoxy group, which enhances its aromatic character. The presence of the aldehyde group indicates that it can participate in various chemical reactions, such as oxidation and condensation. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic aromatic components, while its reactivity can be influenced by the electron-donating and withdrawing effects of the phenoxy group. Additionally, it may have applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its structural features that can facilitate further chemical modifications. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₁₅H₁₄O₂

InChI: InChI=1/C15H14O2/c16-12-4-5-13-8-10-15(11-9-13)17-14-6-2-1-3-7-14/h1-3,6-12H,4-5H2

SMILES: c1ccc(cc1)Oc1ccc(CCC=O)cc1

4-Phenoxybenzenepropanal

Controlled Product

CAS: 54954-44-8

Formula: C₁₅H₁₄O₂

Color and Shape: Neat

Molecular weight: 226.27

Ref: TR-P318170