CAS 5496-35-5
:4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid
Description:
4-(4,5-diphenyl-1H-imidazol-2-yl)benzoic acid, with the CAS number 5496-35-5, is an organic compound characterized by its complex structure, which includes an imidazole ring and a benzoic acid moiety. This compound typically exhibits properties such as being a solid at room temperature, with potential applications in pharmaceuticals and materials science due to its unique molecular configuration. The presence of the imidazole ring suggests potential biological activity, as imidazole derivatives are often found in various biological systems and can act as ligands or catalysts. The diphenyl groups contribute to its hydrophobic character, which may influence its solubility in organic solvents. Additionally, the carboxylic acid functional group in the benzoic acid part of the molecule can participate in hydrogen bonding, affecting its reactivity and interactions with other molecules. Overall, this compound's structural features suggest it may have interesting chemical behavior and potential utility in various applications, including drug development and organic synthesis.
Formula:C22H16N2O2
InChI:InChI=1/C22H16N2O2/c25-22(26)18-13-11-17(12-14-18)21-23-19(15-7-3-1-4-8-15)20(24-21)16-9-5-2-6-10-16/h1-14H,(H,23,24)(H,25,26)
SMILES:c1ccc(cc1)c1c(c2ccccc2)nc(c2ccc(cc2)C(=O)O)[nH]1
Synonyms:- benzoic acid, 4-(4,5-diphenyl-1H-imidazol-2-yl)-
- 4-(4,5-Diphenyl-1H-imidazol-2-yl)benzoic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(4,5-Diphenyl-1H-imidazol-2-yl)benzoic acid
CAS:Formula:C22H16N2O2Purity:98%Color and Shape:SolidMolecular weight:340.37464-(4,5-Diphenyl-1H-Imidazol-2-Yl)Benzoic Acid
CAS:4-(4,5-Diphenyl-1H-Imidazol-2-Yl)Benzoic AcidPurity:99%Molecular weight:340.38g/mol4-(4,5-Diphenyl-1H-imidazol-2-yl)benzoic Acid
CAS:Formula:C22H16N2O2Purity:>98.0%(T)(HPLC)Color and Shape:White to Light yellow powder to crystalMolecular weight:340.38I-XW-053
CAS:I-XW-053 is an inhibitor of capsid targeted HIV-1 replication using the hybrid structure based method to block the interface between CA N-terminal domains (NTD-Formula:C22H16N2O2Purity:99.05%Color and Shape:SolidMolecular weight:340.37




