CAS 54965-01-4

1,2-Dichloro-4-(1-chloroethyl)benzene

Description:

1,2-Dichloro-4-(1-chloroethyl)benzene, with the CAS number 54965-01-4, is an organic compound that belongs to the class of chlorinated aromatic hydrocarbons. It features a benzene ring substituted with two chlorine atoms and a chloroethyl group, which contributes to its chemical reactivity and potential applications. This compound is typically a colorless to pale yellow liquid with a characteristic odor. It is relatively insoluble in water but soluble in organic solvents, which is common for many chlorinated compounds. The presence of multiple chlorine atoms enhances its stability and resistance to degradation, making it useful in various industrial applications, including as an intermediate in the synthesis of other chemicals. However, due to its chlorinated nature, it may pose environmental and health risks, necessitating careful handling and disposal. Its physical and chemical properties, such as boiling point and density, can vary based on purity and specific conditions, but it is generally characterized by a relatively high boiling point compared to non-chlorinated hydrocarbons.

Formula: C₈H₇Cl₃

InChI: InChI=1S/C8H7Cl3/c1-5(9)6-2-3-7(10)8(11)4-6/h2-5H,1H3

InChI key: InChIKey=RFVRMZZXXWUCEA-UHFFFAOYSA-N

SMILES: C(C)(Cl)C1=CC(Cl)=C(Cl)C=C1

Synonyms:

• 1,2-Dichloro-4-(1-chloroethyl)benzene
• α-Methyl-3,4-dichlorobenzyl chloride
• 3,4-Dichloro-α-methylbenzylchloride
• Benzene, 1,2-dichloro-4-(1-chloroethyl)-

1,2-Dichloro-4-(1-chloroethyl)benzene

CAS: 54965-01-4

1,2-Dichloro-4-(1-chloroethyl)benzene is a chemical compound that belongs to the family of aromatic compounds. It is found in the environment as a byproduct of industrial emissions. 1,2-Dichloro-4-(1-chloroethyl)benzene can be found in the crystal structure with hydrogen bonds, stacking, and conformations.

Formula: C₈H₇Cl₃

Purity: Min. 95%

Molecular weight: 209.5 g/mol

Ref: 3D-ECA96501