CAS 54980-22-2
:Physalin D
Description:
Physalin D is a natural compound classified as a steroidal lactone, primarily derived from the Physalis genus, particularly Physalis angulata. It exhibits a complex molecular structure characterized by a fused ring system, which is typical of steroidal compounds. Physalin D is known for its diverse biological activities, including anti-inflammatory, anticancer, and immunomodulatory effects. Its mechanism of action often involves the modulation of various signaling pathways, making it a subject of interest in pharmacological research. The compound is typically studied for its potential therapeutic applications, particularly in cancer treatment, due to its ability to induce apoptosis in certain cancer cell lines. Additionally, Physalin D may exhibit antioxidant properties, contributing to its overall bioactivity. As a natural product, it is often isolated through extraction methods from plant sources, and its purity and concentration can vary based on the extraction technique used. Overall, Physalin D represents a promising area of study in natural product chemistry and medicinal research.
Formula:C28H32O11
InChI:InChI=1/C28H32O11/c1-22-10-17-24(3)28-18(22)19(31)27(39-28,36-11-14(22)20(32)37-17)13-9-16(30)25(34)7-4-5-15(29)23(25,2)12(13)6-8-26(28,35)21(33)38-24/h4-5,12-14,16-18,30,34-35H,6-11H2,1-3H3
InChI key:InChIKey=DUGJJSWZRHBJJK-KLWPSQLOSA-N
SMILES:C[C@]12[C@]34[C@@]5([C@@]6(C)[C@@](CO[C@](O3)(C5=O)[C@]7([C@](CC[C@]4(O)C(=O)O1)([C@]8(C)[C@@](O)([C@H](O)C7)CC=CC8=O)[H])[H])(C(=O)O[C@@]2(C6)[H])[H])[H]
Synonyms:- (1S,2S,3S,6R,6aS,8aR,10aS,10bR,14aR,15R,16aR,17R,18aR)-2,3,6,6a,9,10,10a,14,14a,15,16,16a-Dodecahydro-8a,14a,15-trihydroxy-2,6a,10b-trimethyl-17,3-(epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone
- Physalin D
- 16,24-Cyclo-13,14-secoergost-2-ene-18,26-dioic acid, 14,17:14,27-diepoxy-5,6,13,20,22-pentahydroxy-1,15-dioxo-, γ-lactone δ-lactone, (5α,6β,14α,16β,22α,25S)-
- 17,3-(Epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone, 2,3,6,6a,9,10,10a,14,14a,15,16,16a-dodecahydro-8a,14a,15-trihydroxy-2,6a,10b-trimethyl-, [1S-(1α,2β,3α,6β,6aα,8aα,10aα,10bβ,14aα,15β,16aβ,17α,18aS*)]-
- 17,3-(Epoxymethano)-1,17:2,6-dimethano-17H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,21(1H,8aH,10bH)-tetrone, 2,3,6,6a,9,10,10a,14,14a,15,16,16a-dodecahydro-8a,14a,15-trihydroxy-2,6a,10b-trimethyl-, (1S,2S,3S,6R,6aS,8aR,10aS,10bR,14aR,15R,16aR,17R,18aR)-
- 16,24-Cyclo-13,14-secoergost-2-ene-18,26-dioic acid, 14,17:14,27-diepoxy-5,6,13,20,22-pentahydroxy-1,15-dioxo-, .gamma.-lactone, .delta.-lactone
- Nsc288728
- 16,24-Cyclo-13,14-secoergost-2-ene-18,26-dioic acid, 14,17:14,27-diepoxy-5,6,13,20,22-pentahydroxy-1,15-dioxo-, .gamma.-lactone .delta.-lactone, (5.alpha.,6.beta.,14.alpha.,16.beta.,22.alpha.,25S)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Physalin D
CAS:Physalin D: antimalarial, 32 µg/mL MIC vs. tuberculosis, cytotoxic to cancer cells, antinociceptive.Formula:C28H32O11Purity:98%Color and Shape:SolidMolecular weight:544.553Physalin D
CAS:Physalin D is a bioactive compound that belongs to the class of withanolides, which is derived from the Physalis species of plants. These plants are known for their rich source of steroidal lactones with diverse biological activities. The mode of action of Physalin D involves modulation of cellular pathways, including the inhibition of NF-κB signaling and induction of apoptosis in certain cancer cell lines.
Formula:C28H32O11Purity:Min. 95%Molecular weight:544.50 g/mol

