CAS 54981-11-2

1-oxa-3,9-diazaspiro[5.5]undecan-2-one

Description:

1-Oxa-3,9-diazaspiro[5.5]undecan-2-one, with the CAS number 54981-11-2, is a heterocyclic compound featuring a spiro structure that incorporates both nitrogen and oxygen atoms within its ring system. This compound is characterized by its unique bicyclic framework, which includes a five-membered ring and a seven-membered ring, contributing to its spirocyclic nature. The presence of the oxo group (carbonyl) and the diaza substituents (two nitrogen atoms) enhances its potential for various chemical reactivities, making it of interest in medicinal chemistry and material science. The compound may exhibit specific physical properties such as solubility in polar solvents, and its stability can be influenced by the electronic effects of the nitrogen and oxygen atoms. Additionally, the structural complexity of 1-oxa-3,9-diazaspiro[5.5]undecan-2-one may lead to interesting biological activities, which could be explored in pharmacological studies. Overall, this compound represents a fascinating example of spirocyclic chemistry with potential applications in various fields.

Formula: C₈H₁₄N₂O₂

InChI: InChI=1/C8H14N2O2/c11-7-10-6-3-8(12-7)1-4-9-5-2-8/h9H,1-6H2,(H,10,11)

SMILES: C1CNCCC21CCN=C(O)O2

1-Oxa-3,9-diazaspiro[5.5]undecan-2-one

CAS: 54981-11-2

Formula: C₈H₁₄N₂O₂

Molecular weight: 170.2090

Ref: IN-DA00DKU2

1-Oxa-3,9-diazaspiro[5.5]undecan-2-one

CAS: 54981-11-2

1-Oxa-3,9-diazaspiro[5.5]undecan-2-one is a carbamate that has shown to be an antagonist of the androgen receptor. In vitro studies show that 1-Oxa-3,9-diazaspiro[5.5]undecan-2-one inhibits the proliferation of cells in hyperproliferative disorders. This compound has been shown to have antiviral effects against herpes simplex virus type 1 (HSV1) and 2 (HSV2). The antiviral potency of this drug is increased by template mutation in the viral genome.

Formula: C₈H₁₄N₂O₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 170.21 g/mol

Ref: 3D-ECA98111