CAS 54986-94-6

[2-(2-thienyl)-1,3-thiazol-4-yl]methanol

Description:

[2-(2-thienyl)-1,3-thiazol-4-yl]methanol, with the CAS number 54986-94-6, is a chemical compound characterized by its unique structural features, which include a thiazole ring and a thienyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the hydroxymethyl group (-CH2OH) suggests that it may engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the thiazole and thienyl moieties can contribute to its electronic properties, making it of interest in various fields, including medicinal chemistry and materials science. The compound may also exhibit specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be utilized for its identification and characterization. Overall, [2-(2-thienyl)-1,3-thiazol-4-yl]methanol represents a versatile structure with potential applications in drug development and other chemical research areas.

Formula: C₈H₇NOS₂

InChI: InChI=1/C8H7NOS2/c10-4-6-5-12-8(9-6)7-2-1-3-11-7/h1-3,5,10H,4H2

SMILES: c1cc(c2nc(CO)cs2)sc1

Synonyms:

• (2-Thiophen-2-Yl-1,3-Thiazol-4-Yl)Methanol

[2-(2-thienyl)-1,3-thiazol-4-yl]methanol

CAS: 54986-94-6

[2-(2-thienyl)-1,3-thiazol-4-yl]methanol

Purity: ≥95%

Molecular weight: 197.28g/mol

Ref: 54-OR23155