CAS 54989-33-2
:4-Hydroxycarbazole
Description:
4-Hydroxycarbazole is an organic compound characterized by its structure, which consists of a carbazole core with a hydroxyl group (-OH) attached at the fourth position. This compound typically appears as a white to light yellow solid and is known for its potential applications in organic electronics, particularly in the development of light-emitting diodes (LEDs) and other optoelectronic devices due to its photoluminescent properties. It exhibits moderate solubility in organic solvents, which can facilitate its use in various chemical reactions and formulations. The presence of the hydroxyl group contributes to its reactivity, allowing for further functionalization and derivatization. Additionally, 4-hydroxycarbazole can participate in hydrogen bonding, influencing its physical properties and interactions with other molecules. Its chemical stability and ability to undergo various transformations make it a subject of interest in both synthetic organic chemistry and materials science. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C12H9NO
InChI:InChI=1/C12H9NO/c14-11-7-3-6-10-12(11)8-4-1-2-5-9(8)13-10/h1-7,13-14H
SMILES:c1ccc2c(c1)c1c(cccc1O)[nH]2
Synonyms:- 4-Hydroxy-9H-carbazole
- Hydroxycarbazole
- 9H-Carbazol-4-ol
- 4-Hydroxy Carbazole
- 4-hydroxy carbonzole
- 4-HYDROXYCARBAZOLE
- 4-hydroxy-9-(H)-Carbazol]
- 4 HYDROXY 9(H)CARBAZOLE
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
