CymitQuimica logo

CAS 54992-23-3

:

Sodium nifurstylenate

Description:
Sodium nifurstylenate is a chemical compound that belongs to the class of nitrofuran derivatives, which are known for their antimicrobial properties. It is characterized by its sodium salt form, which enhances its solubility in aqueous solutions, making it suitable for various pharmaceutical applications. The compound exhibits a broad spectrum of activity against bacteria and some protozoa, making it valuable in the treatment of infections. Its mechanism of action typically involves the inhibition of nucleic acid synthesis, leading to the disruption of microbial growth. Sodium nifurstylenate is often studied for its potential use in topical formulations due to its favorable pharmacokinetic properties. Additionally, it may possess anti-inflammatory effects, contributing to its therapeutic profile. Safety and efficacy are critical considerations in its application, and ongoing research continues to explore its full potential in clinical settings. As with any pharmaceutical agent, proper handling and adherence to safety guidelines are essential when working with this compound.
Formula:C13H8NNaO5
InChI:InChI=1/C13H9NO5.Na/c15-13(16)10-4-1-9(2-5-10)3-6-11-7-8-12(19-11)14(17)18;/h1-8H,(H,15,16);/q;+1/p-1/b6-3+;
SMILES:c1cc(ccc1C=Cc1ccc(N(=O)=O)o1)C(=O)O.[Na]
Synonyms:
  • 4-[2-(5-Nitro-2-furyl)vinyl]benzoic acid sodium salt
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.