
CAS 55-65-2
:Guanethidine
Description:
Guanethidine is a chemical compound primarily used as an antihypertensive agent, particularly in the treatment of high blood pressure. It is classified as a sympatholytic drug, which means it works by inhibiting the release of norepinephrine from sympathetic nerve endings, leading to a decrease in peripheral vascular resistance and heart rate. The substance appears as a white to off-white crystalline powder and is soluble in water, making it suitable for injection. Its mechanism of action involves blocking adrenergic receptors, which helps to lower blood pressure effectively. Guanethidine is typically administered under medical supervision due to potential side effects, including orthostatic hypotension, dizziness, and gastrointestinal disturbances. Additionally, it may interact with other medications, necessitating careful management in patients with concurrent therapies. As with any pharmaceutical, proper dosage and monitoring are crucial to ensure safety and efficacy in treatment.
Formula:C10H22N4
InChI:InChI=1S/C10H22N4/c11-10(12)13-6-9-14-7-4-2-1-3-5-8-14/h1-9H2,(H4,11,12,13)
InChI key:InChIKey=ACGDKVXYNVEAGU-UHFFFAOYSA-N
SMILES:C(CNC(=N)N)N1CCCCCCC1
Synonyms:- Guanethidine
- Guanidine, N-[2-(hexahydro-1(2H)-azocinyl)ethyl]-
- N-[2-(Hexahydro-1(2H)-azocinyl)ethyl]guanidine
- Guanidine, [2-(hexahydro-1(2H)-azocinyl)ethyl]-
- Ismelin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Guanethidine
CAS:<p>Guanethidine sulphate, made in 1959, lowers blood pressure by disrupting neurotransmitters in sympathetic nerves.</p>Formula:C10H22N4Color and Shape:SolidMolecular weight:198.31
