CAS 550-21-0
:isotocin
Description:
Isotocin, with the CAS number 550-21-0, is a peptide hormone that is structurally similar to oxytocin, differing only by a single amino acid substitution. It is primarily found in non-mammalian species, particularly in certain fish and amphibians, where it plays a role in various physiological processes, including social bonding, reproductive behaviors, and osmoregulation. Isotocin consists of a chain of nine amino acids and exhibits similar biological activities to oxytocin, such as stimulating uterine contractions and influencing social behaviors. The hormone operates through specific receptors, leading to various intracellular signaling pathways. Isotocin's effects can vary depending on the species and the context in which it is released. In research, isotocin is of interest for its potential applications in understanding the evolution of social behaviors and reproductive strategies across different species. Its study contributes to the broader understanding of peptide hormones and their roles in both vertebrate and invertebrate physiology.
Formula:C41H63N11O12S2
InChI:InChI=1/C41H63N11O12S2/c1-5-20(3)32(39(62)45-16-31(44)56)51-38(61)29-8-7-13-52(29)41(64)28-19-66-65-18-24(42)34(57)46-25(14-22-9-11-23(54)12-10-22)36(59)50-33(21(4)6-2)40(63)48-27(17-53)37(60)47-26(15-30(43)55)35(58)49-28/h9-12,20-21,24-29,32-33,53-54H,5-8,13-19,42H2,1-4H3,(H2,43,55)(H2,44,56)(H,45,62)(H,46,57)(H,47,60)(H,48,63)(H,49,58)(H,50,59)(H,51,61)/t20-,21-,24-,25-,26-,27-,28-,29-,32-,33?/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=NCC(=N)O)O)N=C([C@@H]1CCCN1C(=O)[C@@H]1CSSC[C@@H](C(=N[C@@H](Cc2ccc(cc2)O)C(=NC([C@@H](C)CC)C(=N[C@@H](CO)C(=N[C@@H](CC(=N)O)C(=N1)O)O)O)O)O)N)O
Synonyms:- 4-Ser-8-ile-oxytocin
- 4-Serine-8-isoleucine-oxytocin
- Oxytocin, ser(4)-ile(8)-
- Oxytocin, seryl(4)-isoleucine(8)-
- Oxytocin, 4-L-serine-8-L-isoleucine-
- 1-{[(4R,7S,10S,16S,19R)-19-amino-7-(2-amino-2-oxoethyl)-13-[(2S)-butan-2-yl]-16-(4-hydroxybenzyl)-10-(hydroxymethyl)-6,9,12,15,18-pentaoxo-1,2-dithia-5,8,11,14,17-pentaazacycloicosan-4-yl]carbonyl}-L-prolyl-L-isoleucylglycinamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
(Ser⁴,Ile⁸)-Oxytocin
CAS:Bachem ID: 4030890.
Formula:C41H63N11O12S2Purity:> 98%Color and Shape:White Whitish PowderMolecular weight:966.15(Ser4,Ile8)-Oxytocin
CAS:Oxytocin is a neuropeptide hormone that regulates social behavior and the body's response to stress. It is produced by the hypothalamus, stored in the posterior pituitary gland, and released into the bloodstream. Oxytocin has been shown to regulate the release of prolactin from the anterior pituitary gland, as well as stimulate uterine contractions during labor. Oxytocin also plays a role in regulating blood pressure and vasopressin secretion. The activity of oxytocin is regulated by a number of factors including detection sensitivity, polyclonal antibodies, monoclonal antibodies, polymerase chain reaction (PCR), effective dose, salinity, neurosecretory sequences, and regulatory sequences such as linear regression analysis. Oxytocin has also been shown to have physiological activities including regulation of water balance through antidiuretic effects and modulation of appetite through action on receptors for ghrelin. Oxytocin is an endogenous molecule with a molecular weight of 3Formula:C41H63N11O12S2Purity:Min. 95%Molecular weight:966.14 g/mol

