CAS 550-23-2
:2,4,5-tri(furan-2-yl)-4,5-dihydro-1H-imidazole
Description:
2,4,5-Tri(furan-2-yl)-4,5-dihydro-1H-imidazole is an organic compound characterized by its unique structure, which includes three furan rings attached to a dihydroimidazole core. This compound exhibits notable aromatic properties due to the presence of furan, a five-membered heterocyclic compound containing oxygen. The imidazole ring contributes to its potential biological activity, as imidazole derivatives are often found in various pharmaceuticals and bioactive compounds. The presence of multiple furan groups may enhance its electron-donating properties, making it a candidate for applications in organic electronics or as a ligand in coordination chemistry. Additionally, the compound's solubility and stability can be influenced by the substituents on the furan rings and the imidazole structure. Its CAS number, 550-23-2, allows for easy identification in chemical databases, facilitating research and development in fields such as medicinal chemistry and materials science. Overall, this compound's unique structural features suggest potential utility in various chemical and biological applications.
Formula:C15H12N2O3
InChI:InChI=1/C15H12N2O3/c1-4-10(18-7-1)13-14(11-5-2-8-19-11)17-15(16-13)12-6-3-9-20-12/h1-9,13-14H,(H,16,17)
SMILES:c1cc(C2C(c3ccco3)N=C(c3ccco3)N2)oc1
Synonyms:- 1H-imidazole, 2,4,5-tri-2-furanyl-4,5-dihydro-
- 2,4,5-Tri(2-furyl)-4,5-dihydro-1H-imidazole
- Furfurin
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
