CAS 55007-22-2

4-(2-methoxy-5-methylphenyl)-4-oxobutanoate

Description:

4-(2-methoxy-5-methylphenyl)-4-oxobutanoate, with the CAS number 55007-22-2, is an organic compound characterized by its functional groups and structural features. It contains a butanoate moiety, which is an ester derived from butanoic acid, and a ketone group at the fourth position of the butanoate chain. The presence of a methoxy group and a methyl-substituted phenyl ring contributes to its aromatic character and may influence its reactivity and solubility. This compound is likely to exhibit moderate polarity due to the combination of hydrophobic aromatic regions and hydrophilic functional groups. Its molecular structure suggests potential applications in pharmaceuticals or as an intermediate in organic synthesis, where the unique arrangement of substituents can affect biological activity or chemical reactivity. Additionally, the compound's stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications.

Formula: C₁₂H₁₃O₄

InChI: InChI=1/C12H14O4/c1-8-3-5-11(16-2)9(7-8)10(13)4-6-12(14)15/h3,5,7H,4,6H2,1-2H3,(H,14,15)/p-1

SMILES: Cc1ccc(c(c1)C(=O)CCC(=O)[O-])OC

4-(2-Methoxy-5-methyl-phenyl)-4-oxo-butyric acid

CAS: 55007-22-2

Formula: C₁₂H₁₄O₄

Purity: 97.0%

Molecular weight: 222.24

Ref: 10-F029066

4-(2-Methoxy-5-methyl-phenyl)-4-oxo-butyric acid

CAS: 55007-22-2

Versatile small molecule scaffold

Formula: C₁₂H₁₄O₄

Purity: Min. 95%

Molecular weight: 222.24 g/mol

Ref: 3D-FCA00722