CAS 5503-74-2

3-Borono-2-thiophenecarboxylic acid

Description:

3-Borono-2-thiophenecarboxylic acid is an organoboron compound characterized by the presence of a boron atom, a thiophene ring, and a carboxylic acid functional group. This compound typically exhibits a white to off-white crystalline appearance. The boron atom in its structure contributes to its reactivity, particularly in cross-coupling reactions, making it valuable in organic synthesis and materials science. The thiophene ring, a five-membered aromatic heterocycle containing sulfur, imparts unique electronic properties and can enhance the compound's solubility and stability in various solvents. The carboxylic acid group provides acidic properties, allowing for potential interactions in biological systems and facilitating further chemical modifications. Additionally, 3-Borono-2-thiophenecarboxylic acid can participate in various chemical reactions, including Suzuki coupling, which is significant in the development of pharmaceuticals and agrochemicals. Its versatility and functional groups make it a useful building block in synthetic organic chemistry.

Formula: C₅H₅BO₄S

InChI: InChI=1S/C5H5BO4S/c7-5(8)4-3(6(9)10)1-2-11-4/h1-2,9-10H,(H,7,8)

InChI key: InChIKey=AJNCKPIBBSWSBY-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C(C(O)=O)SC=C1

Synonyms:

• 2-Carboxythiophene-3-boronic acid
• 2-Thiophenecarboxylic acid, 3-borono-
• 3-Borono-2-Thiophenecarboxylic Acid
• Rarechem Al Be 0854

3-BORONO-2-THIOPHENECARBOXYLIC ACID

CAS: 5503-74-2

Formula: C₅H₅BO₄S

Purity: 95%

Color and Shape: Solid

Molecular weight: 171.9668

Ref: IN-DA00DDU4

2-Carboxythiophene-3-boronic acid

CAS: 5503-74-2

Purity: ≥95%

Molecular weight: 171.9600067

Ref: 10-F627974

2-Carboxythiophene-3-boronic Acid

Controlled Product

CAS: 5503-74-2

Applications 2-carboxythiophene-3-boronic acid (cas# 5503-74-2) is a useful research chemical.

Formula: C₅H₅BO₄S

Color and Shape: Neat

Molecular weight: 171.97

Ref: TR-B415938