CAS 550346-18-4

2-(Acetylamino)-3-fluorobenzoic acid

Description:

2-(Acetylamino)-3-fluorobenzoic acid, with the CAS number 550346-18-4, is an organic compound that features both an acetylamino group and a fluorine atom attached to a benzoic acid structure. This compound typically exhibits characteristics such as being a solid at room temperature, with a specific melting point that can vary based on purity and crystalline form. It is likely to be soluble in polar solvents such as water and methanol, while showing limited solubility in non-polar solvents. The presence of the acetylamino group suggests potential for hydrogen bonding, which can influence its solubility and reactivity. The fluorine atom may impart unique electronic properties, potentially affecting the compound's reactivity and interaction with biological systems. This compound may be of interest in pharmaceutical research due to its structural features, which could contribute to biological activity. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.

Formula: C₉H₈FNO₃

InChI: InChI=1S/C9H8FNO3/c1-5(12)11-8-6(9(13)14)3-2-4-7(8)10/h2-4H,1H3,(H,11,12)(H,13,14)

InChI key: InChIKey=CRYXMLONVFAWEC-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=C(C(O)=O)C=CC=C1F

Synonyms:

• 2-(Acetylamino)-3-Fluorobenzoic Acid
• Benzoic Acid, 2-(Acetylamino)-3-Fluoro-
• 2-Acetamido-3-fluorobenzoic acid

2-Acetamido-3-fluorobenzoic acid

CAS: 550346-18-4

Formula: C₉H₈FNO₃

Molecular weight: 197.1631

Ref: IN-DA00DBSX

2-Acetamido-3-fluorobenzoic acid

CAS: 550346-18-4

2-Acetamido-3-fluorobenzoic acid

Formula: C₉H₈FNO₃

Purity: ≥95%

Color and Shape: white crystalline solid

Molecular weight: 197.16g/mol

Ref: 54-PC9979

2-Acetamido-3-fluorobenzoic acid

CAS: 550346-18-4

Formula: C₉H₈FNO₃

Purity: 95.0%

Molecular weight: 197.165

Ref: 10-F237406