CAS 550363-85-4

2-fluoro-5-formylbenzoic acid

Description:

2-Fluoro-5-formylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a formyl group (-CHO) and a fluorine atom attached to a benzene ring. The molecular structure features a fluorine substituent at the ortho position relative to the carboxylic acid group and a formyl group at the meta position. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. It exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and nucleophilic substitution. The presence of the fluorine atom can influence the compound's reactivity and polarity, potentially enhancing its biological activity or altering its interaction with other molecules. 2-Fluoro-5-formylbenzoic acid may be utilized in organic synthesis, pharmaceuticals, and materials science, where its unique functional groups can serve as intermediates or building blocks for more complex compounds.

Formula: C₈H₅FO₃

InChI: InChI=1/C8H5FO3/c9-7-2-1-5(4-10)3-6(7)8(11)12/h1-4H,(H,11,12)

SMILES: c1cc(c(cc1C=O)C(=O)O)F

Synonyms:

• 2-Fluoro-5-formyl-benzoic acid
• 2-fluoro-5-formylbenzoic acid

2-Fluoro-5-formylbenzoic acid

CAS: 550363-85-4

Formula: C₈H₅FO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 168.1219

Ref: IN-DA0037M1

2-Fluoro-5-formylbenzoic acid

CAS: 550363-85-4

2-Fluoro-5-formylbenzoic acid

Formula: C₈H₅FO₃

Purity: 95%

Color and Shape: off white powder

Molecular weight: 168.12g/mol

Ref: 54-PC2916

Olaparib Impurity 19

CAS: 550363-85-4

Formula: C₈H₅FO₃

Color and Shape: White To Off-White Solid

Molecular weight: 168.12

Ref: 4Z-O-032021

2-Fluoro-5-formylbenzoic acid

CAS: 550363-85-4

Formula: C₈H₅FO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 168.123

Ref: 10-F065703

2-Fluoro-5-formylbenzoic acid

CAS: 550363-85-4

2-Fluoro-5-formylbenzoic acid is a biomolecule that is used in the synthesis of fatty acids. It is produced by the enzymatic oxidation of ethylene. 2-Fluoro-5-formylbenzoic acid can be used for process optimization and to improve the production of fatty acids. This compound has been shown to inhibit the formation of phosphite, which is an intermediate in the synthesis of fatty acids. 2-Fluoro-5-formylbenzoic acid has also been shown to have formylation activity, which can lead to its use as a precursor for pharmaceuticals and other organic compounds.

Formula: C₈H₅FO₃

Purity: Min. 95%

Molecular weight: 168.12 g/mol

Ref: 3D-FF79414

Olaparib Impurity 30

CAS: 550363-85-4

Formula: C₈H₅FO₃

Molecular weight: 168.12

Ref: ST-EA-CP-O6058