CAS 550363-85-4
:2-fluoro-5-formylbenzoic acid
Description:
2-Fluoro-5-formylbenzoic acid is an aromatic carboxylic acid characterized by the presence of a formyl group (-CHO) and a fluorine atom attached to a benzene ring. The molecular structure features a fluorine substituent at the ortho position relative to the carboxylic acid group and a formyl group at the meta position. This compound is typically a white to off-white solid and is soluble in polar solvents due to the presence of the carboxylic acid functional group. It exhibits acidic properties, allowing it to participate in various chemical reactions, such as esterification and nucleophilic substitution. The presence of the fluorine atom can influence the compound's reactivity and polarity, potentially enhancing its biological activity or altering its interaction with other molecules. 2-Fluoro-5-formylbenzoic acid may be utilized in organic synthesis, pharmaceuticals, and materials science, where its unique functional groups can serve as intermediates or building blocks for more complex compounds.
Formula:C8H5FO3
InChI:InChI=1/C8H5FO3/c9-7-2-1-5(4-10)3-6(7)8(11)12/h1-4H,(H,11,12)
SMILES:c1cc(c(cc1C=O)C(=O)O)F
Synonyms:- 2-Fluoro-5-formyl-benzoic acid
- 2-fluoro-5-formylbenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
2-Fluoro-5-formylbenzoic acid
CAS:Formula:C8H5FO3Purity:97%Color and Shape:SolidMolecular weight:168.1219Ref: IN-DA0037M1
1g77.00€5g149.00€10g171.00€1kgTo inquire25g305.00€2kgTo inquire50g675.00€100gTo inquire500gTo inquire100mg49.00€250mg50.00€2-Fluoro-5-formylbenzoic acid
CAS:2-Fluoro-5-formylbenzoic acidFormula:C8H5FO3Purity:95%Color and Shape: off white powderMolecular weight:168.12g/molOlaparib Impurity 19
CAS:Formula:C8H5FO3Color and Shape:White To Off-White SolidMolecular weight:168.122-Fluoro-5-formylbenzoic acid
CAS:Formula:C8H5FO3Purity:95%Color and Shape:SolidMolecular weight:168.1232-Fluoro-5-formylbenzoic acid
CAS:2-Fluoro-5-formylbenzoic acid is a biomolecule that is used in the synthesis of fatty acids. It is produced by the enzymatic oxidation of ethylene. 2-Fluoro-5-formylbenzoic acid can be used for process optimization and to improve the production of fatty acids. This compound has been shown to inhibit the formation of phosphite, which is an intermediate in the synthesis of fatty acids. 2-Fluoro-5-formylbenzoic acid has also been shown to have formylation activity, which can lead to its use as a precursor for pharmaceuticals and other organic compounds.Formula:C8H5FO3Purity:Min. 95%Molecular weight:168.12 g/mol





