CAS 55038-27-2
:(1aS,4E,10aS,11E,14aS)-1a,5,8,12-tetramethyl-2,3,6,7,10a,13,14,14a-octahydrooxireno[9,10]cyclotetradeca[1,2-b]furan-9(1aH)-one
Description:
The chemical substance with the name "(1aS,4E,10aS,11E,14aS)-1a,5,8,12-tetramethyl-2,3,6,7,10a,13,14,14a-octahydrooxireno[9,10]cyclotetradeca[1,2-b]furan-9(1aH)-one" and CAS number "55038-27-2" is a complex organic compound characterized by its unique stereochemistry and structural features. It belongs to a class of compounds known as terpenoids, which are often derived from natural sources and exhibit a variety of biological activities. The presence of multiple chiral centers indicates that this compound can exist in different stereoisomeric forms, which can significantly influence its chemical behavior and interactions. The structure includes a fused ring system, which contributes to its rigidity and potential reactivity. Additionally, the presence of functional groups such as ketones and ethers suggests that it may participate in various chemical reactions, including nucleophilic attacks and oxidation. Overall, this compound's intricate structure and stereochemistry make it of interest in fields such as medicinal chemistry and natural product synthesis.
Formula:C20H28O3
InChI:InChI=1/C20H28O3/c1-13-6-5-11-20(4)18(23-20)10-8-14(2)12-17-16(9-7-13)15(3)19(21)22-17/h6,12,17-18H,5,7-11H2,1-4H3/b13-6+,14-12+/t17-,18-,20-/m0/s1
InChI key:InChIKey=CGAKBBMRMLAYMY-BUHUPKIQSA-N
SMILES:C[C@]12[C@@](O1)(CC\C(\C)=C\[C@]3(C(CC\C(\C)=C\CC2)=C(C)C(=O)O3)[H])[H]
Synonyms:- (+)-Sarcophine
- (1aS,4E,10aS,11E,14aS)-2,3,6,7,10a,13,14,14a-Octahydro-1a,5,8,12-tetramethyloxireno[9,10]cyclotetradeca[1,2-b]furan-9(1aH)-one
- (2S,7S,8S)-Sarcophine
- NSC 250434
- Oxireno[9,10]cyclotetradeca[1,2-b]furan-9(1aH)-one, 2,3,6,7,10a,13,14,14a-octahydro-1a,5,8,12-tetramethyl-, [1aS-(1aR*,4E,10aR*,11E,14aR*)]-
- Sarcophin
- Sarcophin A
- oxireno[9,10]cyclotetradeca[1,2-b]furan-9(1aH)-one, 2,3,6,7,10a,13,14,14a-octahydro-1a,5,8,12-tetramethyl-, (1aS,4E,10aS,11E,14aS)-
- (1aS,4E,10aS,11E,14aS)-1a,5,8,12-Tetramethyl-2,3,6,7,10a,13,14,14a-octahydrooxireno[9,10]cyclotetradeca[1,2-b]furan-9(1aH)-one
- Oxireno(9,10)cyclotetradeca(1,2-B)furan-9(1ah)-one, 2,3,6,7,10A,13,14,14A-octahydro-1A,5,8,12-tetramethyl- (van) (9ci)
- Sarcophyne
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Sarcophine
CAS:Sarcophine is a natural cembranoid from the Red Sea soft coral Sarcophyton glaucum.Formula:C20H28O3Color and Shape:SolidMolecular weight:316.441

