CAS 55038-30-7
:(2E,4E,12E)-13-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)trideca-2,4,12-trienamide
Description:
The chemical substance known as (2E,4E,12E)-13-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)trideca-2,4,12-trienamide, with the CAS number 55038-30-7, is a complex organic compound characterized by its unique structural features. It contains a trideca-2,4,12-trienamide backbone, which indicates the presence of multiple double bonds (conjugated system) along with an amide functional group. The presence of the 1,3-benzodioxole moiety suggests potential aromatic properties, contributing to its stability and reactivity. The N-(2-methylpropyl) substituent indicates that the amide nitrogen is bonded to a branched alkyl group, which can influence the compound's solubility and biological activity. This compound may exhibit interesting pharmacological properties due to its structural complexity, making it a candidate for various applications in medicinal chemistry. Its synthesis and characterization would typically involve advanced organic synthesis techniques, and its behavior in biological systems could be explored through various assays to determine its efficacy and safety profile.
Formula:C24H33NO3
InChI:InChI=1/C24H33NO3/c1-20(2)18-25-24(26)14-12-10-8-6-4-3-5-7-9-11-13-21-15-16-22-23(17-21)28-19-27-22/h8,10-17,20H,3-7,9,18-19H2,1-2H3,(H,25,26)/b10-8+,13-11+,14-12+
Synonyms:- 2,4,12-tridecatrienamide, 13-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)-, (2E,4E,12E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(2E,4E,12E)-13-(Benzo[d][1,3]dioxol-5-yl)-N-isobutyltrideca-2,4,12-trienamide
CAS:Formula:C24H33NO3Purity:98.0%Molecular weight:383.5237Guineensine
CAS:Guineensine is an alkaloid, which is a naturally occurring compound found in the plant species Piper nigrum, commonly known as black pepper. This bioactive alkaloid is noted for its interaction with various biological systems, predominantly through its activity as a reuptake inhibitor of key neurotransmitters such as serotonin and dopamine. By inhibiting the reuptake of these neurotransmitters, guineensine can modulate their levels in the synaptic cleft, potentially influencing mood and related behavioral parameters.Formula:C24H33NO3Purity:Min. 95%Molecular weight:383.52 g/molGuineesine
CAS:Guineesine is an Acyl-CoA. It acts by inhibiting cholesterol acyltransferase.Formula:C24H33NO3Purity:98%Color and Shape:SolidMolecular weight:383.52



