CAS 55042-50-7
:5,11-dimethyl-6H-pyrido[4,3-b]carbazole 2,3-dihydroxybutanedioate (salt)
Description:
5,11-Dimethyl-6H-pyrido[4,3-b]carbazole 2,3-dihydroxybutanedioate (salt), with the CAS number 55042-50-7, is a chemical compound that belongs to the class of pyrido-carbazole derivatives. This compound typically exhibits a complex structure characterized by a fused ring system, which contributes to its unique chemical properties. The presence of the dimethyl groups enhances its hydrophobic characteristics, while the dihydroxybutanedioate moiety introduces functional groups that can participate in hydrogen bonding and other interactions. This compound may exhibit biological activity, potentially influencing various biochemical pathways, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can be influenced by the salt formation, which often enhances its bioavailability. Additionally, the compound's structural features may allow for interactions with specific receptors or enzymes, suggesting potential applications in drug development or as a research tool in studying biological processes. However, detailed studies are necessary to fully elucidate its properties and potential uses.
Formula:C21H20N2O6
InChI:InChI=1/C17H14N2.C4H6O6/c1-10-14-9-18-8-7-12(14)11(2)17-16(10)13-5-3-4-6-15(13)19-17;5-1(3(7)8)2(6)4(9)10/h3-9,19H,1-2H3;1-2,5-6H,(H,7,8)(H,9,10)/t;1-,2-/m.1/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ellipticine tartrate
CAS:<p>Ellipticine tartrate is a DNA intercalating agent and a DNA topoisomerase II inhibitor.</p>Formula:C21H20N2O6Color and Shape:SolidMolecular weight:396.39
