CymitQuimica logo

CAS 55044-33-2

:

2-butyl-5-hexyloctahydro-1H-indene

Description:
2-Butyl-5-hexyloctahydro-1H-indene, with the CAS number 55044-33-2, is a chemical compound characterized by its complex hydrocarbon structure. It belongs to the class of indenes, which are bicyclic compounds featuring a five-membered ring fused to a six-membered ring. This particular compound exhibits a significant degree of saturation due to the presence of multiple carbon-carbon single bonds, contributing to its stability and potentially influencing its reactivity. The presence of butyl and hexyl substituents indicates that it has a relatively high molecular weight and may exhibit hydrophobic properties. Its structure suggests that it could be a liquid at room temperature, with potential applications in organic synthesis or as an intermediate in the production of more complex molecules. Additionally, the presence of multiple alkyl groups may enhance its solubility in non-polar solvents and affect its physical properties, such as boiling point and viscosity. Overall, 2-butyl-5-hexyloctahydro-1H-indene is a versatile compound with potential utility in various chemical applications.
Formula:C19H36
InChI:InChI=1/C19H36/c1-3-5-7-8-10-16-11-12-18-14-17(9-6-4-2)15-19(18)13-16/h16-19H,3-15H2,1-2H3
SMILES:CCCCCCC1CCC2CC(CCCC)CC2C1
Synonyms:
  • 1H-Indene, 2-butyl-5-hexyloctahydro-
  • Bicyclo[4.3.0]nonane, 8-butyl-3-hexyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.