CAS 5505-63-5: D-Mannosamine hydrochloride
Description:D-Mannosamine hydrochloride is an amino sugar and a derivative of mannose, characterized by the presence of an amine group (-NH2) at the C-2 position. It appears as a white to off-white crystalline powder and is soluble in water, making it suitable for various biological applications. The hydrochloride form enhances its stability and solubility. D-Mannosamine plays a crucial role in glycoprotein synthesis and is involved in cellular processes, including cell signaling and adhesion. It is often studied for its potential therapeutic applications, particularly in the fields of immunology and cancer research, due to its ability to influence glycosylation patterns on cell surfaces. Additionally, it can serve as a substrate for the synthesis of other biologically relevant compounds. As with many amino sugars, it is important to handle D-mannosamine hydrochloride with care, following appropriate safety protocols, as it may have biological effects that require further investigation in specific contexts.
Formula:C6H13NO5·ClH
InChI:InChI=1S/C6H13NO5.ClH/c7-3(1-8)5(11)6(12)4(10)2-9;/h1,3-6,9-12H,2,7H2;1H/t3-,4-,5-,6-;/m1./s1
InChI key:InChIKey=CBOJBBMQJBVCMW-MVNLRXSJSA-N
SMILES:Cl.O=CC(N)C(O)C(O)C(O)CO
- Synonyms:
- (3R,4S,5R)-3,4,5,6-tetrahydroxy-L-norleucine hydrochloride (1:1)
- 2-Amino-2-deoxy-<span class="text-smallcaps">D</span>-mannose hydrochloride
- 2-Amino-2-deoxy-D-mannopyranose hydrochloride
- 2-amino-2-deoxy-D-mannose hydrochloride
- <span class="text-smallcaps">D</span>-(+)-Mannosamine hydrochloride
- <span class="text-smallcaps">D</span>-Mannose, 2-amino-2-deoxy-, hydrochloride
- <span class="text-smallcaps">D</span>-Mannose, 2-amino-2-deoxy-, hydrochloride (1:1)
- D-Mannosamine, HCl
- Mannose, 2-amino-2-deoxy-, hydrochloride, <span class="text-smallcaps">D</span>-
- D-Mannosamine hydrochloride
- See more synonyms
- D-Mannose, 2-amino-2-deoxy-, hydrochloride
- D-Mannosamine, Hydrochloride
- Mannose, 2-amino-2-deoxy-, hydrochloride, D-
- D-Mannose, 2-amino-2-deoxy-, hydrochloride (1:1)
