
CAS 55066-49-4
:3-Methyl-5-phenyl-1-pentanal
Description:
3-Methyl-5-phenyl-1-pentanal, with the CAS number 55066-49-4, is an organic compound characterized by its aldehyde functional group, which is indicative of its reactivity and potential applications in organic synthesis. This compound features a five-carbon straight-chain backbone with a methyl group and a phenyl group attached to the third and fifth carbon atoms, respectively. The presence of the aldehyde group contributes to its characteristic odor and makes it a potential candidate for use in flavoring and fragrance industries. Additionally, the structure suggests that it may exhibit moderate polarity due to the aldehyde functional group, influencing its solubility in various solvents. The compound's reactivity can also be attributed to the aldehyde group, which can participate in various chemical reactions, including oxidation and condensation. Overall, 3-Methyl-5-phenyl-1-pentanal is a versatile compound with potential applications in synthetic organic chemistry and industrial processes.
Formula:C12H16O
InChI:InChI=1S/C12H16O/c1-11(9-10-13)7-8-12-5-3-2-4-6-12/h2-6,10-11H,7-9H2,1H3
InChI key:InChIKey=DFJMIMVMOIFPQG-UHFFFAOYSA-N
SMILES:C(CC(CC=O)C)C1=CC=CC=C1
Synonyms:- β-Methylbenzenepentanal
- 3-Methyl-5-phenylpentanal
- Benzenepentanal, β-methyl-
- Mefranal
- Methylphenylpentanal
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.