CAS 5508-47-4
:gibberellin A7 methyl ester
Description:
Gibberellin A7 methyl ester, with the CAS number 5508-47-4, is a synthetic derivative of gibberellin, a class of plant hormones known for their role in promoting growth and development. This compound is characterized by its ability to stimulate cell elongation, seed germination, and flowering in various plant species. Gibberellin A7 methyl ester is typically used in agricultural and horticultural applications to enhance crop yield and improve fruit quality. Its chemical structure includes a methyl ester functional group, which influences its solubility and biological activity compared to its parent gibberellin compounds. The compound is generally applied in low concentrations, as its potent biological effects can lead to significant physiological changes in plants. Additionally, gibberellin A7 methyl ester is often studied for its potential in research related to plant physiology and developmental biology, providing insights into the mechanisms of plant growth regulation. As with other gibberellins, its use must be carefully managed to avoid adverse effects on plant health and development.
Formula:C23H28ClN3O3
InChI:InChI=1/C23H28ClN3O3/c1-4-21(28)27-15-13-26(14-16-27)19-9-7-18(8-10-19)25-22(29)23(2,3)30-20-11-5-17(24)6-12-20/h5-12H,4,13-16H2,1-3H3,(H,25,29)
SMILES:CCC(=O)N1CCN(CC1)c1ccc(cc1)NC(=O)C(C)(C)Oc1ccc(cc1)Cl
Synonyms:- 2-(4-chlorophenoxy)-2-methyl-N-[4-(4-propanoylpiperazin-1-yl)phenyl]propanamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Gibberellin A7 Methyl Ester
CAS:Controlled ProductFormula:C20H24O5Color and Shape:NeatMolecular weight:344.4
