CAS 55082-33-2
:5-Bromo-2-hydroxybenzophenone
Description:
5-Bromo-2-hydroxybenzophenone, with the CAS number 55082-33-2, is an organic compound that belongs to the class of benzophenones, which are characterized by their two phenyl rings connected by a carbonyl group. This particular compound features a bromine atom and a hydroxyl group positioned on the benzene rings, which significantly influence its chemical properties and reactivity. It is typically a solid at room temperature and is known for its applications in organic synthesis and as a UV filter in various formulations. The presence of the hydroxyl group contributes to its potential as a hydrogen bond donor, while the bromine atom can enhance its reactivity in electrophilic substitution reactions. Additionally, 5-Bromo-2-hydroxybenzophenone exhibits photostability and can absorb UV light, making it useful in protecting materials from UV degradation. Its solubility varies depending on the solvent, and it is often handled with care due to potential toxicity and environmental considerations.
Formula:C13H9BrO2
InChI:InChI=1/C13H9BrO2/c14-10-6-7-12(15)11(8-10)13(16)9-4-2-1-3-5-9/h1-8,15H
SMILES:c1ccc(cc1)C(=O)c1cc(ccc1O)Br
Synonyms:- (5-Bromo-2-hydroxyphenyl)(phenyl)methanone
- Methanone, (5-Bromo-2-Hydroxyphenyl)Phenyl-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-hydroxybenzophenone
CAS:Formula:C13H9BrO2Purity:>98.0%(T)Color and Shape:Light yellow to Yellow to Orange powder to crystalMolecular weight:277.125-Bromo-2-hydroxybenzophenone, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C13H9BrO2Purity:97%Color and Shape:Yellow, PowderMolecular weight:277.12(5-Bromo-2-hydroxyphenyl)(phenyl)methanone
CAS:Formula:C13H9BrO2Purity:98%Color and Shape:SolidMolecular weight:277.11345-Bromo-2-hydroxybenzophenone
CAS:5-Bromo-2-hydroxybenzophenoneFormula:C13H9BrO2Purity:99%Color and Shape: yellow powderMolecular weight:277.11336g/mol5-BROMO-2-HYDROXYBENZOPHENONE
CAS:Formula:C13H9BrO2Purity:99%(GC-MS);RGColor and Shape:SolidMolecular weight:277.117




