CAS 55096-88-3

N-benzyl-1-(4-fluorophenyl)methanamine

Description:

N-benzyl-1-(4-fluorophenyl)methanamine, with the CAS number 55096-88-3, is an organic compound characterized by its amine functional group and aromatic structure. It features a benzyl group attached to a methanamine backbone, along with a para-fluorophenyl substituent. This compound is typically a solid at room temperature and exhibits properties common to amines, such as basicity and the ability to form hydrogen bonds. The presence of the fluorine atom in the para position of the phenyl ring can influence its electronic properties, potentially enhancing lipophilicity and altering its reactivity compared to non-fluorinated analogs. N-benzyl-1-(4-fluorophenyl)methanamine may be of interest in medicinal chemistry and drug development due to its structural features, which can affect biological activity and interaction with various targets. Its synthesis and characterization would involve standard organic chemistry techniques, and it may be utilized in research related to pharmacology or materials science.

Formula: C₁₄H₁₄FN

InChI: InChI=1/C14H14FN/c15-14-8-6-13(7-9-14)11-16-10-12-4-2-1-3-5-12/h1-9,16H,10-11H2

SMILES: c1ccc(cc1)CNCc1ccc(cc1)F

Synonyms:

• Benzenemethanamine, 4-fluoro-N-(phenylmethyl)-
• N-Benzyl-1-(4-fluorophenyl)methanamine

BENZYL-(4-FLUORO-BENZYL)-AMINE

CAS: 55096-88-3

Formula: C₁₄H₁₄FN

Purity: 97%

Molecular weight: 215.2661

Ref: IN-DA00D99B

N-benzyl-1-(4-fluorophenyl)methanamine hydrochloride

CAS: 55096-88-3

Formula: C₁₄H₁₅ClFN

Purity: 97%

Molecular weight: 251.73

Ref: 10-F361107