CAS 55096-89-4

4-Bromo-N-(phenylmethyl)benzenemethanamine

Description:

4-Bromo-N-(phenylmethyl)benzenemethanamine, also known by its CAS number 55096-89-4, is an organic compound characterized by the presence of a bromine atom and an amine functional group. This compound features a benzene ring substituted with a bromine atom at the para position relative to a benzenemethanamine moiety, which includes a phenylmethyl group. The molecular structure suggests that it may exhibit properties typical of both aromatic compounds and amines, such as potential for hydrogen bonding and varied solubility in organic solvents. The presence of the bromine atom can influence its reactivity, making it a candidate for electrophilic substitution reactions. Additionally, the compound may exhibit biological activity, which is common among amine derivatives, potentially making it of interest in pharmaceutical research. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions between its functional groups and the solvent environment. Overall, 4-Bromo-N-(phenylmethyl)benzenemethanamine is a compound of interest in organic synthesis and medicinal chemistry.

Formula: C₁₄H₁₄BrN

InChI: InChI=1S/C14H14BrN/c15-14-8-6-13(7-9-14)11-16-10-12-4-2-1-3-5-12/h1-9,16H,10-11H2

InChI key: InChIKey=QXBYDLUZMIWCRP-UHFFFAOYSA-N

SMILES: C(NCC1=CC=CC=C1)C2=CC=C(Br)C=C2

Synonyms:

• 4-Bromo-N-(phenylmethyl)benzenemethanamine
• N-Benzyl-1-(4-bromophenyl)methanamine
• Benzyl(4-bromobenzyl)amine
• Benzenemethanamine, 4-bromo-N-(phenylmethyl)-
• 4-Bromodibenzylamine

Benzyl[(4-bromophenyl)methyl]amine

CAS: 55096-89-4

Versatile small molecule scaffold

Formula: C₁₄H₁₄BrN

Purity: Min. 95%

Molecular weight: 276.17 g/mol

Ref: 3D-FCA09689