CAS 55099-31-5

ethyl 10-bromodecanoate

Description:

Ethyl 10-bromodecanoate is an organic compound classified as an ester, specifically derived from the reaction of decanoic acid and bromine. It features a long hydrophobic carbon chain, which contributes to its lipophilic properties, making it soluble in organic solvents but less so in water. The presence of the bromine atom at the 10th carbon position introduces a halogen functionality, which can influence its reactivity and potential applications in organic synthesis, particularly in the formation of carbon-carbon bonds or as a precursor in various chemical reactions. Ethyl 10-bromodecanoate typically exhibits a moderate boiling point and melting point, characteristic of esters with long carbon chains. Its structure allows for potential uses in the synthesis of pharmaceuticals, agrochemicals, or as a reagent in organic chemistry. Safety considerations should be taken into account when handling this compound, as brominated compounds can pose health risks. Proper storage and handling protocols are essential to ensure safety and stability.

Formula: C₁₂H₂₃BrO₂

InChI: InChI=1/C12H23BrO2/c1-2-15-12(14)10-8-6-4-3-5-7-9-11-13/h2-11H2,1H3

SMILES: CCOC(=O)CCCCCCCCCBr

Synonyms:

• Decanoic Acid, 10-Bromo-, Ethyl Ester
• Ethyl-10-bromdecanoat

Ethyl 10-Bromodecanoate

CAS: 55099-31-5

Formula: C₁₂H₂₃BrO₂

Purity: >96.0%(GC)

Color and Shape: Colorless to Almost colorless clear liquid

Molecular weight: 279.22

Ref: 3B-B2265

Ethyl 10-Bromodecanoate

CAS: 55099-31-5

Formula: C₁₂H₂₃BrO₂

Purity: 97%

Color and Shape: Liquid

Molecular weight: 279.2138

Ref: IN-DA003Q0C

Ethyl 10-Bromodecanoate

CAS: 55099-31-5

Ethyl 10-Bromodecanoate

Purity: 97%

Molecular weight: 279.21g/mol

Ref: 54-OR1013131

Ethyl 10-bromodecanoate

CAS: 55099-31-5

Formula: C₁₂H₂₃BrO₂

Purity: 97%

Molecular weight: 279.218

Ref: 10-F545890