CAS 550998-54-4

methyl 7-fluoro-1-benzothiophene-2-carboxylate

Description:

Methyl 7-fluoro-1-benzothiophene-2-carboxylate is a chemical compound characterized by its unique structure, which includes a benzothiophene core, a carboxylate functional group, and a fluorine substituent. This compound typically exhibits properties associated with heterocyclic aromatic compounds, such as moderate to high stability and potential reactivity due to the presence of the carboxylate group. The fluorine atom can influence the compound's electronic properties, potentially enhancing its lipophilicity and altering its interaction with biological systems. Methyl 7-fluoro-1-benzothiophene-2-carboxylate may be of interest in medicinal chemistry and materials science due to its potential applications in drug development and as a building block for synthesizing more complex molecules. Its solubility characteristics, melting point, and boiling point would depend on the specific conditions and purity of the compound. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₁₀H₇FO₂S

InChI: InChI=1/C10H7FO2S/c1-13-10(12)8-5-6-3-2-4-7(11)9(6)14-8/h2-5H,1H3

SMILES: COC(=O)c1cc2cccc(c2s1)F

Synonyms:

• Methyl-7-fluor-1-benzothiophen-2-carboxylat
• 7-Fluoro-Benzo[B]Thiophene-2-Carboxylic Acid Methyl Ester

7-Fluoro-benzo[b]thiophene-2-carboxylic acid methyl ester

CAS: 550998-54-4

Formula: C₁₀H₇FO₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 210.2248

Ref: IN-DA00DCW7

Methyl 7-fluorobenzo[b]thiophene-2-carboxylate

CAS: 550998-54-4

Methyl 7-fluorobenzo[b]thiophene-2-carboxylate

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 210.22g/mol

Ref: 54-PC8596

Methyl 7-fluorobenzo[b]thiophene-2-carboxylate

CAS: 550998-54-4

Formula: C₁₀H₇FO₂S

Purity: 98%

Molecular weight: 210.22

Ref: 10-F240525