CAS 550999-75-2

(R)-7-Chloro-N-(quinuclidin-3-yl)benzo[b]thiophene-2-carboxamide

Description:

(R)-7-Chloro-N-(quinuclidin-3-yl)benzo[b]thiophene-2-carboxamide is a chemical compound characterized by its unique structural features, including a benzo[b]thiophene core, a chloro substituent, and a quinuclidinyl moiety. This compound is notable for its potential pharmacological applications, particularly in the field of neuroscience, where it may interact with specific receptors in the central nervous system. The presence of the chloro group enhances its lipophilicity, which can influence its bioavailability and interaction with biological targets. The quinuclidinyl group contributes to its ability to modulate neurotransmitter systems, making it a subject of interest in drug development. Additionally, the compound's stereochemistry, indicated by the (R) configuration, is crucial for its biological activity, as stereoisomers can exhibit significantly different pharmacological profiles. Overall, (R)-7-Chloro-N-(quinuclidin-3-yl)benzo[b]thiophene-2-carboxamide represents a complex and potentially valuable molecule in medicinal chemistry research.

Formula: C₁₆H₁₇ClN₂OS

InChI: InChI=1S/C16H17ClN2OS/c17-12-3-1-2-11-8-14(21-15(11)12)16(20)18-13-9-19-6-4-10(13)5-7-19/h1-3,8,10,13H,4-7,9H2,(H,18,20)/t13-/m0/s1

InChI key: InChIKey=SSRDSYXGYPJKRR-ZDUSSCGKSA-N

SMILES: ClC1=C2C(C=C(C(N[C@@H]3C4CCN(C3)CC4)=O)S2)=CC=C1

Synonyms:

• (R)-7-Chloro-N-(quinuclidin-3-yl)benzo[b]thiophene-2-carboxamide
• Benzo[b]thiophene-2-carboxamide, N-(3R)-1-azabicyclo[2.2.2]oct-3-yl-7-chloro-
• N-(3R)-1-Azabicyclo[2.2.2]oct-3-yl-7-chlorobenzo[b]thiophene-2-carboxamide
• Encenicline
• EVP 6124

Encenicline

CAS: 550999-75-2

Encenicline

Purity: ≥95%

Molecular weight: 320.84g/mol

Ref: 54-BUP07688

Encenicline

CAS: 550999-75-2

Encenicline (EVP-6124), a selective α7 nAChRs agonist, targets cognitive impairment in schizophrenia and Alzheimer's.

Formula: C₁₆H₁₇ClN₂OS

Purity: 99.20%

Color and Shape: Solid

Molecular weight: 320.84

Ref: TM-T7193

ENCENICLINE

CAS: 550999-75-2

Formula: C₁₆H₁₇ClN₂OS

Purity: 99%

Molecular weight: 320.84

Ref: 10-F531213