CAS 551-72-4: (-)-chiro-Inositol

Description:(-)-Chiro-Inositol is a naturally occurring stereoisomer of inositol, specifically classified as a cyclic sugar alcohol. It is characterized by its six-membered ring structure, which contains six carbon atoms and multiple hydroxyl (–OH) groups, contributing to its solubility in water. This compound plays a significant role in cellular signaling and is involved in various biological processes, including insulin signaling and lipid metabolism. (-)-Chiro-Inositol is often studied for its potential therapeutic effects, particularly in conditions like polycystic ovary syndrome (PCOS) and metabolic disorders. It is known to influence glucose metabolism and improve insulin sensitivity. The compound is typically found in various plant sources and can also be synthesized in the laboratory. Its chemical properties include a relatively low molecular weight and a specific optical rotation, which is indicative of its chiral nature. Overall, (-)-Chiro-Inositol is an important molecule in both biochemistry and pharmacology, with ongoing research into its health benefits and applications.

Formula:C₆H₁₂O₆

InChI:InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H

InChI key:InChIKey=CDAISMWEOUEBRE-UHFFFAOYSA-N

SMILES:OC1C(O)C(O)C(O)C(O)C1O

Synonyms:
(-)-chiro-Inositol
(1R,2R,3R,4R,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol
1L-chiro-Inositol
1L-chiro-inositol
L-chiro-Inositol
Inositol, L-chiro-
L-chiro-Inositol
Inositol, L-chiro-

Found 3 products.

Product data	Purity	Price range	Estimated delivery
(1R,2R,3R,4R,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol REF: IN-DA003R6GCAS: 551-72-4	98%	119.00 €~592.00 €	Thu 17 Apr 25
1L-chiro-Inositol REF: 7W-GC7626CAS: 551-72-4	≥ 98.0%	89.00 €~292.00 €	Thu 24 Apr 25
1L-chiro-Inositol REF: 3D-MI07484CAS: 551-72-4	Min. 95 Area-%	152.00 €~1,227.00 €	Mon 28 Apr 25