CAS 551-72-4
:(-)-chiro-Inositol
Description:
(-)-Chiro-Inositol is a naturally occurring stereoisomer of inositol, specifically classified as a cyclic sugar alcohol. It is characterized by its six-membered ring structure, which contains six carbon atoms and multiple hydroxyl (–OH) groups, contributing to its solubility in water. This compound plays a significant role in cellular signaling and is involved in various biological processes, including insulin signaling and lipid metabolism. (-)-Chiro-Inositol is often studied for its potential therapeutic effects, particularly in conditions like polycystic ovary syndrome (PCOS) and metabolic disorders. It is known to influence glucose metabolism and improve insulin sensitivity. The compound is typically found in various plant sources and can also be synthesized in the laboratory. Its chemical properties include a relatively low molecular weight and a specific optical rotation, which is indicative of its chiral nature. Overall, (-)-Chiro-Inositol is an important molecule in both biochemistry and pharmacology, with ongoing research into its health benefits and applications.
Formula:C6H12O6
InChI:InChI=1S/C6H12O6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-12H
InChI key:InChIKey=CDAISMWEOUEBRE-UHFFFAOYSA-N
SMILES:OC1C(O)C(O)C(O)C(O)C1O
Synonyms:- (-)-chiro-Inositol
- (1R,2R,3R,4R,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol
- 1<span class="text-smallcaps">L</span>-chiro-Inositol
- 1L-chiro-inositol
- <span class="text-smallcaps">L</span>-chiro-Inositol
- Inositol, <span class="text-smallcaps">L</span>-chiro-
- L-chiro-Inositol
- Inositol, L-chiro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
(1R,2R,3R,4R,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol
CAS:Formula:C6H12O6Purity:98%Color and Shape:SolidMolecular weight:180.15591L-chiro-Inositol
CAS:Formula:C6H12O6Purity:≥ 98.0%Color and Shape:White to off-white powderMolecular weight:180.16L-chiro-Inositol
CAS:L-chiro-Inositol is a stereoisomer of inositol, which is a type of sugar alcohol and a critical component of cell membranes. Derived from natural sources such as plants and animals, L-chiro-Inositol plays a significant role in cellular processes through its involvement in the phosphoinositide signaling pathway. This pathway is crucial for mediating various cellular responses to external signals, particularly in the modulation of insulin signaling and glucose metabolism. By influencing insulin signaling pathways, L-chiro-Inositol contributes to the regulation of glucose uptake and utilization, making it an important compound in studies related to metabolic health, diabetes, and insulin resistance. Researchers also investigate its potential therapeutic applications in managing polycystic ovary syndrome (PCOS) due to its role in improving insulin sensitivity and ovulatory function. Its contribution to cell membrane structure and function further extends its relevance in studies exploring cell signaling, growth, and survival. L-chiro-Inositol serves as a vital compound for scientists examining the intricate interplay between cellular signaling mechanisms and metabolic disorders.Formula:C6H12O6Purity:Min. 95 Area-%Color and Shape:PowderMolecular weight:180.16 g/mol


