
CAS 551-85-9
:D-Ribulose 5-phosphate
Description:
D-Ribulose 5-phosphate is a five-carbon sugar phosphate, classified as a ketopentose. It plays a crucial role in cellular metabolism, particularly in the pentose phosphate pathway, which is essential for nucleotide synthesis and the generation of reducing power in the form of NADPH. The molecular formula of D-Ribulose 5-phosphate is C5H11O8P, and it features a phosphate group attached to the ribulose backbone, which is a key structural characteristic that influences its reactivity and function in biochemical pathways. This compound exists in equilibrium between its open-chain form and cyclic forms, which can participate in various enzymatic reactions. D-Ribulose 5-phosphate is also involved in the Calvin cycle of photosynthesis, where it is converted into ribulose bisphosphate, facilitating carbon fixation. Its presence is vital for the proper functioning of metabolic processes in both prokaryotic and eukaryotic organisms. As a biochemical intermediate, it is typically found in cellular environments and is not commonly isolated in pure form.
Formula:C5H11O8P
InChI:InChI=1S/C5H11O8P/c6-1-3(7)5(9)4(8)2-13-14(10,11)12/h4-6,8-9H,1-2H2,(H2,10,11,12)/t4-,5+/m1/s1
InChI key:InChIKey=FNZLKVNUWIIPSJ-UHNVWZDZSA-N
SMILES:[C@@H]([C@@H](COP(=O)(O)O)O)(C(CO)=O)O
Synonyms:- Ribulose 5-phosphoric acid
- D-erythro-Pentulose, 5-(dihydrogen phosphate)
- D-Ribulose-5-phosphoric acid
- D-erythro-Pentulose, 5-phosphate
- D-RIBULOSE 5-PHOSPHATE
- D-erythro-2-Pentulose, 5-(dihydrogen phosphate)
- D-Ribulose 5-phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
D-Ribulose 5-phosphate
CAS:D-Ribulose 5-phosphate is a phosphorylated sugar, which is a key intermediate in the pentose phosphate pathway, derived from the enzymatic phosphorylation of D-ribulose. This pathway is crucial in cells for the generation of NADPH and the synthesis of ribose-5-phosphate, which is essential for nucleotide biosynthesis. The compound is produced from ribulose via the action of ribose-phosphate isomerase, a crucial enzyme in cellular metabolism.D-Ribulose 5-phosphate primarily functions as a precursor in the biosynthesis of nucleotides and nucleic acids. It acts within the cellular context to balance the supply of ribose-5-phosphate for nucleotide production, while its role in the oxidative branch of the pentose phosphate pathway helps maintain redox homeostasis through NADPH production.The primary application of D-Ribulose 5-phosphate is in biochemical research and metabolic engineering, where it is vital for studies focusing on metabolic flux analysis and the elucidation of biosynthetic pathways. Understanding its pathway and regulation can lead to insights into metabolic disorders and the development of therapeutic strategies targeting nucleotide synthesis abnormalities.Formula:C5H11O8PMolecular weight:230.11 g/mol
