CAS 5510-99-6
:2,6-Di-sec-butylphenol
Description:
2,6-Di-sec-butylphenol is an organic compound characterized by its phenolic structure, featuring two sec-butyl groups attached to the 2 and 6 positions of the benzene ring. This compound is typically a viscous liquid or solid at room temperature, exhibiting a relatively high boiling point due to the presence of bulky alkyl groups that increase molecular weight and hinder volatility. It is known for its hydrophobic nature, making it less soluble in water but more soluble in organic solvents. 2,6-Di-sec-butylphenol possesses antioxidant properties, which makes it useful in various industrial applications, including as a stabilizer in plastics and rubber. Additionally, it can act as a precursor in the synthesis of other chemical compounds. The compound's structure contributes to its chemical stability, but it may undergo reactions typical of phenolic compounds, such as oxidation or substitution. Safety data indicates that, like many phenolic compounds, it should be handled with care due to potential irritant effects on skin and eyes.
Formula:C14H22O
InChI:InChI=1S/C14H22O/c1-5-10(3)12-8-7-9-13(14(12)15)11(4)6-2/h7-11,15H,5-6H2,1-4H3
InChI key:InChIKey=FHTGJZOULSYEOB-UHFFFAOYSA-N
SMILES:C(CC)(C)C1=C(O)C(C(CC)C)=CC=C1
Synonyms:- 2,6-Bis(1-methylpropyl)phenol
- 2,6-Bis(butan-2-yl)phenol
- 2,6-Bis(sec-butyl)phenol
- 2,6-Di(Butan-2-Yl)Phenol
- 2,6-Di-sec-butylphenol
- 2,6-bis[(1R)-1-methylpropyl]phenol
- 2,6-bis[(1S)-1-methylpropyl]phenol
- 2-[(1R)-1-methylpropyl]-6-[(1S)-1-methylpropyl]phenol
- Di-Sec-Butylphenol, Mixed Isomers
- Phenol, 2,6-bis(1-methylpropyl)-
- Phenol, 2,6-di-sec-butyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Di-sec-butylphenol, mixture of isomers, predom. 2,6-isomer
CAS:Controlled ProductApplications Di-sec-butylphenol, mixture of isomers, predom. 2,6-isomer (cas# 5510-99-6) is a useful research chemical.
Not a dangerous good if item is equal to or less than 1g/ml and there is less than 100g/ml in the packageFormula:C14H22OColor and Shape:NeatMolecular weight:206.324

