CAS 55100-07-7
:6-hydroxy-2,3-dihydro-4H-pyran-4-one
Description:
6-Hydroxy-2,3-dihydro-4H-pyran-4-one, with the CAS number 55100-07-7, is an organic compound characterized by its pyranone structure, which features a six-membered ring containing both oxygen and carbon atoms. This compound is notable for its hydroxyl group at the 6-position and a carbonyl group within the ring, contributing to its reactivity and potential applications in organic synthesis. It typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. The presence of the hydroxyl group enhances its solubility in polar solvents, making it useful in various chemical reactions, including those involving nucleophilic attacks. Additionally, this compound may exhibit biological activity, which has drawn interest in medicinal chemistry and natural product synthesis. Its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 6-hydroxy-2,3-dihydro-4H-pyran-4-one is a versatile compound with potential utility in various fields of chemistry.
Formula:C5H6O3
InChI:InChI=1/C5H6O3/c6-4-1-2-8-5(7)3-4/h3,7H,1-2H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
