CAS 55100-59-9
:1,3-dinitrotricyclo[3.3.1.1~3,7~]decane
Description:
1,3-Dinitrotricyclo[3.3.1.1^3,7]decane, with the CAS number 55100-59-9, is a chemical compound known for its unique structural features and energetic properties. It belongs to the class of nitro compounds and is characterized by the presence of two nitro groups (-NO2) attached to a tricyclic decane framework. This compound exhibits high stability under normal conditions but can be sensitive to heat and shock, making it of interest in the field of explosives and propellants. Its molecular structure contributes to its energetic characteristics, which include a high density and potential for significant energy release upon decomposition. The compound is typically handled with caution due to its potential hazards, including toxicity and explosive behavior. In terms of solubility, it is generally less soluble in water but may dissolve in organic solvents. Overall, 1,3-dinitrotricyclo[3.3.1.1^3,7]decane is a notable compound in both synthetic chemistry and materials science, particularly in applications related to energetic materials.
Formula:C10H14N2O4
InChI:InChI=1/C10H14N2O4/c13-11(14)9-2-7-1-8(4-9)5-10(3-7,6-9)12(15)16/h7-8H,1-6H2
SMILES:C1C2CC3(CC1CC(C2)(C3)N(=O)=O)N(=O)=O
Synonyms:- 1,3-Dinitroadamantane
- Tricyclo[3.3.1.1~3,7~]Decane, 1,3-Dinitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
1,3-Dinitroadamantane
CAS:<p>1,3-Dinitroadamantane is a reactive compound that is used in the synthesis of 1-nitropropane. It is also used as a catalyst for the conversion of phosphoribosyl pyrophosphate to adenosine monophosphate. 1,3-Dinitroadamantane can be hydrolyzed by carbon tetrachloride and acyclovir to form guanosine and leishmania. This compound has also been shown to cause regression of visceral leishmaniasis in mice. The mechanism of action for this compound is not yet known but it may involve the conversion of purines to pyrimidines or inhibition of DNA synthesis.</p>Formula:C10H14N2O4Purity:Min. 95%Molecular weight:226.23 g/mol
