CymitQuimica logo

CAS 55104-32-0

:

1(3H)-Isobenzofuranone, 6-hydroxy-

Description:
1(3H)-Isobenzofuranone, 6-hydroxy- is an organic compound characterized by its bicyclic structure, which includes a fused isobenzofuranone moiety with a hydroxyl group at the 6-position. This compound typically exhibits properties associated with both aromatic and cyclic structures, contributing to its stability and reactivity. It is likely to be a colorless to pale yellow solid or liquid, depending on its purity and specific conditions. The presence of the hydroxyl group suggests potential for hydrogen bonding, influencing its solubility in polar solvents and its reactivity in various chemical reactions, such as esterification or oxidation. Additionally, compounds of this type may exhibit biological activity, making them of interest in medicinal chemistry and materials science. The CAS number 55104-32-0 uniquely identifies this substance, facilitating its recognition in chemical databases and literature. Overall, 1(3H)-Isobenzofuranone, 6-hydroxy- represents a versatile compound with potential applications in various fields of chemistry.
Formula:C8H6O3
InChI:InChI=1S/C8H6O3/c9-6-2-1-5-4-11-8(10)7(5)3-6/h1-3,9H,4H2
InChI key:HWIZGBVJDMPJRO-UHFFFAOYSA-N
SMILES:C1C2=C(C=C(C=C2)O)C(=O)O1
Found 3 products.