CAS 55104-39-7

7-[3-(tert-butylamino)-2-hydroxypropoxy]-2-benzofuran-1(3H)-one hydrochloride (1:1)

Description:

7-[3-(tert-Butylamino)-2-hydroxypropoxy]-2-benzofuran-1(3H)-one hydrochloride is a chemical compound characterized by its complex structure, which includes a benzofuran moiety and a tert-butylamino group. This compound typically exhibits properties such as solubility in polar solvents due to the presence of hydroxyl and amino functional groups, which can engage in hydrogen bonding. The hydrochloride form indicates that it is a salt, enhancing its stability and solubility in aqueous environments. The presence of the benzofuran ring suggests potential biological activity, as many compounds with similar structures are known for their pharmacological properties. Additionally, the tert-butylamino group may contribute to its lipophilicity, influencing its interaction with biological membranes. Overall, this compound's unique structural features may make it of interest in medicinal chemistry, particularly in the development of therapeutic agents. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₁₅H₂₂ClNO₄

InChI: InChI=1/C15H21NO4.ClH/c1-15(2,3)16-7-11(17)9-19-12-6-4-5-10-8-20-14(18)13(10)12;/h4-6,11,16-17H,7-9H2,1-3H3;1H

SMILES: CC(C)(C)NCC(COc1cccc2COC(=O)c12)O.Cl

Synonyms:

• 1(3H)-Isobenzofuranone, 7-(3-((1,1-dimethylethyl)amino)-2-hydroxypropoxy)-, hydrochloride

DL-071-IT

CAS: 55104-39-7

DL-071-IT

Purity: ≥98%

Ref: 54-BUP22767

Afurolol Hydrochloride

CAS: 55104-39-7

Afurolol Hydrochloride (DL 071-IT) is a non-selective β-adrenergic receptor antagonist. DL 071 IT exhibits intrinsic sympathomimetic activity.

Formula: C₁₅H₂₂ClNO₄

Purity: 98.86%

Color and Shape: Solid

Molecular weight: 315.79

Ref: TM-T5450